Difference between revisions of "Tiso gene 8353"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12826 CPD-12826] == * smiles: ** C(NC1(C=CC(C(=O)NC(C(=O)[O-])CCC([O-])=O)=CC=1))C2(C=NC3(N...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=P641-PWY P641-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12826 CPD-12826] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=P641-PWY P641-PWY] ==
−
* smiles:
+
* taxonomic range:
−
** C(NC1(C=CC(C(=O)NC(C(=O)[O-])CCC([O-])=O)=CC=1))C2(C=NC3(N=C(N)NC(=O)C(N=2)=3))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
−
* inchi key:
+
−
** InChIKey=OVBPIULPVIDEAO-LBPRGKRZSA-L
+
 
* common name:
 
* common name:
−
** folate
+
** phenylmercury acetate degradation
−
* molecular weight:
+
−
** 439.387   
+
 
* Synonym(s):
 
* Synonym(s):
−
** folic acid
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[3.4.17.11-RXN]]
+
* '''1''' reaction(s) found
−
== Reaction(s) known to produce the compound ==
+
** [[MERCURY-II-REDUCTASE-RXN]]
−
== Reaction(s) of unknown directionality ==
+
== Reaction(s) not found ==
 +
* '''1''' reaction(s) not found
 +
** [http://metacyc.org/META/NEW-IMAGE?object=R581-RXN R581-RXN]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* UM-BBD-PWY : ogm
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=1549092 1549092]
+
{{#set: taxonomic range=TAX-2}}
−
* CHEMSPIDER:
+
{{#set: common name=phenylmercury acetate degradation}}
−
** [http://www.chemspider.com/Chemical-Structure.1266060.html 1266060]
+
{{#set: reaction found=1}}
−
* CHEBI:
+
{{#set: reaction not found=1}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62501 62501]
+
−
* HMDB : HMDB00121
+
−
{{#set: smiles=C(NC1(C=CC(C(=O)NC(C(=O)[O-])CCC([O-])=O)=CC=1))C2(C=NC3(N=C(N)NC(=O)C(N=2)=3))}}
+
−
{{#set: inchi key=InChIKey=OVBPIULPVIDEAO-LBPRGKRZSA-L}}
+
−
{{#set: common name=folate}}
+
−
{{#set: molecular weight=439.387    }}
+
−
{{#set: common name=folic acid}}
+
−
{{#set: consumed by=3.4.17.11-RXN}}
+

Revision as of 15:37, 10 January 2018

Pathway P641-PWY

  • taxonomic range:
  • common name:
    • phenylmercury acetate degradation
  • Synonym(s):

Reaction(s) found

Reaction(s) not found

External links

  • UM-BBD-PWY : ogm



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_8353&oldid=9767"