Difference between revisions of "RXN-16133"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=AKBLIG-RXN AKBLIG-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** glycine_c-acetyltransfera...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11401 CPD-11401] == * smiles: ** C([O-])(=O)C1(OC(C(O)C(O)C(O)1)OC(=O)C(N)CC2(=CC(I)=C(C(I)...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=AKBLIG-RXN AKBLIG-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11401 CPD-11401] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C([O-])(=O)C1(OC(C(O)C(O)C(O)1)OC(=O)C(N)CC2(=CC(I)=C(C(I)=C2)OC3(=CC(I)=C(O)C(I)=C3)))
 +
* inchi key:
 +
** InChIKey=HMTFXPJOBPIOIN-DKBYMCRTSA-M
 
* common name:
 
* common name:
−
** glycine_c-acetyltransferase
+
** L-thyroxine acyl β-D-glucuronide
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/2.3.1.29 EC-2.3.1.29]
+
** 951.992   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[CO-A]][c] '''+''' 1 [[AMINO-OXOBUT]][c] '''=>''' 1 [[GLY]][c] '''+''' 1 [[ACETYL-COA]][c]
+
* [[RXN-10608]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 coenzyme A[c] '''+''' 1 L-2-amino-3-oxobutanoate[c] '''=>''' 1 glycine[c] '''+''' 1 acetyl-CoA[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_3555]]
+
−
** IN-SILICO_ANNOTATION
+
−
***AUTOMATED-NAME-MATCH
+
−
== Pathways  ==
+
−
* [[THREONINE-DEG2-PWY]], L-threonine degradation II: [http://metacyc.org/META/NEW-IMAGE?object=THREONINE-DEG2-PWY THREONINE-DEG2-PWY]
+
−
** '''2''' reactions found over '''2''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=20736 20736]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657991 90657991]
−
* LIGAND-RXN:
+
{{#set: smiles=C([O-])(=O)C1(OC(C(O)C(O)C(O)1)OC(=O)C(N)CC2(=CC(I)=C(C(I)=C2)OC3(=CC(I)=C(O)C(I)=C3)))}}
−
** [http://www.genome.jp/dbget-bin/www_bget?R00371 R00371]
+
{{#set: inchi key=InChIKey=HMTFXPJOBPIOIN-DKBYMCRTSA-M}}
−
** [http://www.genome.jp/dbget-bin/www_bget?R00370 R00370]
+
{{#set: common name=L-thyroxine acyl β-D-glucuronide}}
−
* UNIPROT:
+
{{#set: molecular weight=951.992    }}
−
** [http://www.uniprot.org/uniprot/Q9RRY6 Q9RRY6]
+
{{#set: produced by=RXN-10608}}
−
** [http://www.uniprot.org/uniprot/O58030 O58030]
+
−
** [http://www.uniprot.org/uniprot/Q9UY32 Q9UY32]
+
−
** [http://www.uniprot.org/uniprot/O31777 O31777]
+
−
** [http://www.uniprot.org/uniprot/Q22768 Q22768]
+
−
** [http://www.uniprot.org/uniprot/P0AB77 P0AB77]
+
−
{{#set: direction=LEFT-TO-RIGHT}}
+
−
{{#set: common name=glycine_c-acetyltransferase}}
+
−
{{#set: ec number=EC-2.3.1.29}}
+
−
{{#set: gene associated=Tiso_gene_3555}}
+
−
{{#set: in pathway=THREONINE-DEG2-PWY}}
+
−
{{#set: reconstruction category=annotation}}
+
−
{{#set: reconstruction tool=pathwaytools}}
+
−
{{#set: reconstruction source=in-silico_annotation}}
+

Revision as of 15:37, 10 January 2018

Metabolite CPD-11401

  • smiles:
    • C([O-])(=O)C1(OC(C(O)C(O)C(O)1)OC(=O)C(N)CC2(=CC(I)=C(C(I)=C2)OC3(=CC(I)=C(O)C(I)=C3)))
  • inchi key:
    • InChIKey=HMTFXPJOBPIOIN-DKBYMCRTSA-M
  • common name:
    • L-thyroxine acyl β-D-glucuronide
  • molecular weight:
    • 951.992
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C([O-])(=O)C1(OC(C(O)C(O)C(O)1)OC(=O)C(N)CC2(=CC(I)=C(C(I)=C2)OC3(=CC(I)=C(O)C(I)=C3)))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-16133&oldid=9768"