Difference between revisions of "ARYLDIALKYL-PHOSPHATASE-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1301 CPD-1301] == * smiles: ** C([CH]2(NC1(C(NC(=NC=1NC2)N)=O)))NC3(=CC=C(C(NC(C(=O)[O-])CC...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-220 RXN1G-220] == * direction: ** LEFT-TO-RIGHT * common name: ** cis,cis-delta17,35-3-hydrox...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1301 CPD-1301] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-220 RXN1G-220] ==
−
* smiles:
+
* direction:
−
** C([CH]2(NC1(C(NC(=NC=1NC2)N)=O)))NC3(=CC=C(C(NC(C(=O)[O-])CCC(NC(C(=O)[O-])CCC(NC(C(=O)[O-])CCC([O-])=O)=O)=O)=O)C=C3)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=RXWVHRYZTWZATH-XSLAGTTESA-J
+
 
* common name:
 
* common name:
−
** tetrahydropteroyl tri-L-glutamate
+
** cis,cis-delta17,35-3-hydroxyC54:2-[acyl-carrier protein] dehydratase
−
* molecular weight:
+
** 3-hydroxyacyl-[acyl-carrier-protein] dehydratase
−
** 699.633   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/4.2.1.59 EC-4.2.1.59]
 
* Synonym(s):
 
* Synonym(s):
−
** H4PteGlu3
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
== Reaction(s) of unknown directionality ==
+
** 1 [[cis-cis-D17-35-3-hydroxyC54-2-ACPs]][c] '''=>''' 1 [[WATER]][c] '''+''' 1 [[trans-D2-cis-cis-D17-35-C54-3-ACPs]][c]
−
* [[HOMOCYSMET-RXN]]
+
* With common name(s):
 +
** 1 a cis,cis-delta17,35-3-hydroxyC54:2-[acp][c] '''=>''' 1 H2O[c] '''+''' 1 a trans-delta2-cis,cis-delta17,35-C54:3-[acp][c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Tiso_gene_6884]]
 +
** EXPERIMENTAL_ANNOTATION
 +
***AUTOMATED-NAME-MATCH
 +
== Pathways  ==
 +
* [[PWYG-321]], mycolate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWYG-321 PWYG-321]
 +
** '''86''' reactions found over '''182''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* [[annotation]]:
 +
** [[pathwaytools]]:
 +
*** [[experimental_annotation]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49791999 49791999]
+
{{#set: common name=cis,cis-delta17,35-3-hydroxyC54:2-[acyl-carrier protein] dehydratase}}
−
* CHEMSPIDER:
+
{{#set: common name=3-hydroxyacyl-[acyl-carrier-protein] dehydratase}}
−
** [http://www.chemspider.com/Chemical-Structure.17625690.html 17625690]
+
{{#set: ec number=EC-4.2.1.59}}
−
* CHEBI:
+
{{#set: gene associated=Tiso_gene_6884}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58140 58140]
+
{{#set: in pathway=PWYG-321}}
−
* LIGAND-CPD:
+
{{#set: reconstruction category=annotation}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C04144 C04144]
+
{{#set: reconstruction tool=pathwaytools}}
−
* HMDB : HMDB12290
+
{{#set: reconstruction source=experimental_annotation}}
−
{{#set: smiles=C([CH]2(NC1(C(NC(=NC=1NC2)N)=O)))NC3(=CC=C(C(NC(C(=O)[O-])CCC(NC(C(=O)[O-])CCC(NC(C(=O)[O-])CCC([O-])=O)=O)=O)=O)C=C3)}}
+
−
{{#set: inchi key=InChIKey=RXWVHRYZTWZATH-XSLAGTTESA-J}}
+
−
{{#set: common name=tetrahydropteroyl tri-L-glutamate}}
+
−
{{#set: molecular weight=699.633    }}
+
−
{{#set: common name=H4PteGlu3}}
+
−
{{#set: consumed or produced by=HOMOCYSMET-RXN}}
+

Revision as of 15:37, 10 January 2018

Reaction RXN1G-220

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • cis,cis-delta17,35-3-hydroxyC54:2-[acyl-carrier protein] dehydratase
    • 3-hydroxyacyl-[acyl-carrier-protein] dehydratase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWYG-321, mycolate biosynthesis: PWYG-321
    • 86 reactions found over 182 reactions in the full pathway

Reconstruction information

External links

"cis,cis-delta17,35-3-hydroxyC54:2-[acyl-carrier protein] dehydratase" cannot be used as a page name in this wiki.
"3-hydroxyacyl-[acyl-carrier-protein] dehydratase" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=ARYLDIALKYL-PHOSPHATASE-RXN&oldid=9818"