Difference between revisions of "Tiso gene 20218"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4581 CPD-4581] == * smiles: ** CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(CC(=O)CCC(C)1C=2CCC(C)...")
 
(Created page with "Category:Gene == Gene Tiso_gene_13799 == * left end position: ** 7217 * transcription direction: ** POSITIVE * right end position: ** 9278 * centisome position: ** 76.3865...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4581 CPD-4581] ==
+
== Gene Tiso_gene_13799 ==
−
* smiles:
+
* left end position:
−
** CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(CC(=O)CCC(C)1C=2CCC(C)34))))
+
** 7217
−
* inchi key:
+
* transcription direction:
−
** InChIKey=AUNLIRXIJAVBNM-ZSBATXSLSA-N
+
** POSITIVE
−
* common name:
+
* right end position:
−
** 5α-cholesta-8,24-dien-3-one
+
** 9278
−
* molecular weight:
+
* centisome position:
−
** 382.628    
+
** 76.386536    
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[DOLICHYLDIPHOSPHATASE-RXN]]
−
* [[RXN66-318]]
+
** in-silico_annotation
−
== Reaction(s) of unknown directionality ==
+
***automated-name-match
 +
** [[pantograph]]-[[athaliana]]
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=7217}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=22298942 22298942]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=9278}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=52386 52386]
+
{{#set: centisome position=76.386536   }}
−
{{#set: smiles=CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(CC(=O)CCC(C)1C=2CCC(C)34))))}}
+
{{#set: reaction associated=DOLICHYLDIPHOSPHATASE-RXN}}
−
{{#set: inchi key=InChIKey=AUNLIRXIJAVBNM-ZSBATXSLSA-N}}
+
−
{{#set: common name=5α-cholesta-8,24-dien-3-one}}
+
−
{{#set: molecular weight=382.628   }}
+
−
{{#set: produced by=RXN66-318}}
+

Revision as of 15:38, 10 January 2018

Gene Tiso_gene_13799

  • left end position:
    • 7217
  • transcription direction:
    • POSITIVE
  • right end position:
    • 9278
  • centisome position:
    • 76.386536
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_20218&oldid=9842"