Difference between revisions of "PWY-7356"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDROXYNAPHTHOATE DIHYDROXYNAPHTHOATE] == * smiles: ** C([O-])(=O)C1(=C(O)C2(=C(C(O)=C1)C=CC=...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-CYSTEATE L-CYSTEATE] == * smiles: ** C(C([N+])C(=O)[O-])S(=O)(=O)[O-] * inchi key: ** InChIKe...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-CYSTEATE L-CYSTEATE] == |
* smiles: | * smiles: | ||
| − | ** C([ | + | ** C(C([N+])C(=O)[O-])S(=O)(=O)[O-] |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=XVOYSCVBGLVSOL-REOHCLBHSA-M |
* common name: | * common name: | ||
| − | ** | + | ** L-cysteate |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 168.144 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** L-cysteic acid |
| − | ** | + | ** 3-sulfoalanine |
| + | ** 2-amino-3-sulfopropionic acid | ||
| + | ** (R)-cysteate | ||
| + | ** 3-sulfo-L-alanine | ||
| + | ** (2R)-2-amino-3-sulfopropanoic acid | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[RXN-11737]] | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7140381 7140381] |
| + | * HMDB : HMDB02757 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00506 C00506] | ||
* CHEMSPIDER: | * CHEMSPIDER: | ||
| − | ** [http://www.chemspider.com/Chemical-Structure. | + | ** [http://www.chemspider.com/Chemical-Structure.5482600.html 5482600] |
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58090 58090] |
| − | * | + | * METABOLIGHTS : MTBLC58090 |
| − | + | {{#set: smiles=C(C([N+])C(=O)[O-])S(=O)(=O)[O-]}} | |
| − | + | {{#set: inchi key=InChIKey=XVOYSCVBGLVSOL-REOHCLBHSA-M}} | |
| − | {{#set: smiles=C([ | + | {{#set: common name=L-cysteate}} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: molecular weight=168.144 }} |
| − | {{#set: common name= | + | {{#set: common name=L-cysteic acid|3-sulfoalanine|2-amino-3-sulfopropionic acid|(R)-cysteate|3-sulfo-L-alanine|(2R)-2-amino-3-sulfopropanoic acid}} |
| − | {{#set: molecular weight= | + | {{#set: consumed or produced by=RXN-11737}} |
| − | {{#set: common name= | + | |
| − | {{#set: consumed by= | + | |
Revision as of 15:39, 10 January 2018
Contents
Metabolite L-CYSTEATE
- smiles:
- C(C([N+])C(=O)[O-])S(=O)(=O)[O-]
- inchi key:
- InChIKey=XVOYSCVBGLVSOL-REOHCLBHSA-M
- common name:
- L-cysteate
- molecular weight:
- 168.144
- Synonym(s):
- L-cysteic acid
- 3-sulfoalanine
- 2-amino-3-sulfopropionic acid
- (R)-cysteate
- 3-sulfo-L-alanine
- (2R)-2-amino-3-sulfopropanoic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
- HMDB : HMDB02757
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC58090
"C(C([N+])C(=O)[O-])S(=O)(=O)[O-" cannot be used as a page name in this wiki.
