Difference between revisions of "DNA-Ligase-L-lysine"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-3-DIHYDROXYBENZOATE 2-3-DIHYDROXYBENZOATE] == * smiles: ** C(C1(=CC=CC(=C1O)O))([O-])=O * inc...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=P181-PWY P181-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-201174 TAX-...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=P181-PWY P181-PWY] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-201174 TAX-201174] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** nicotine degradation I (pyridine pathway) |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | == Reaction(s) | + | * '''2''' reaction(s) found |
− | * [[ | + | ** [[GABATRANSAM-RXN]] |
− | == | + | ** [[SUCCSEMIALDDEHYDROG-RXN]] |
+ | == Reaction(s) not found == | ||
+ | * '''15''' reaction(s) not found | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=NICOTINE-DEHYDROGENASE-RXN NICOTINE-DEHYDROGENASE-RXN] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-13072 RXN-13072] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-13071 RXN-13071] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-13070 RXN-13070] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=R181-RXN R181-RXN] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=R161-RXN R161-RXN] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-13068 RXN-13068] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-13069 RXN-13069] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-16526 RXN-16526] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=1.14.13.10-RXN 1.14.13.10-RXN] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-16528 RXN-16528] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=R162-RXN R162-RXN] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-16527 RXN-16527] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-13065 RXN-13065] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=RXN-13067 RXN-13067] | ||
== External links == | == External links == | ||
− | * | + | * UM-BBD-PWY : nic |
− | + | {{#set: taxonomic range=TAX-201174}} | |
− | + | {{#set: common name=nicotine degradation I (pyridine pathway)}} | |
− | + | {{#set: reaction found=2}} | |
− | + | {{#set: reaction not found=15}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + |
Revision as of 15:39, 10 January 2018
Pathway P181-PWY
- taxonomic range:
- common name:
- nicotine degradation I (pyridine pathway)
- Synonym(s):
Reaction(s) found
- 2 reaction(s) found
Reaction(s) not found
- 15 reaction(s) not found
External links
- UM-BBD-PWY : nic