Difference between revisions of "LIPOYL-AMP"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12482 CPD-12482] == * smiles: ** CN1(C(=O)NC2(=C1C(=O)NC(=O)N(C)2)) * inchi key: ** InChIKe...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-474-R-2-HYDROXYSTEARATE/ATP/CO-A//CPD-14717/AMP/PPI.48. RXN66-474-R-2-HYDROXYSTEARATE/ATP/CO-...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-474-R-2-HYDROXYSTEARATE/ATP/CO-A//CPD-14717/AMP/PPI.48. RXN66-474-R-2-HYDROXYSTEARATE/ATP/CO-A//CPD-14717/AMP/PPI.48.] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | = | + | * With identifiers: |
| − | * [[ | + | ** 1.0 [[CO-A]][c] '''+''' 1.0 [[ATP]][c] '''+''' 1.0 [[R-2-HYDROXYSTEARATE]][c] '''=>''' 1.0 [[CPD-14717]][c] '''+''' 1.0 [[AMP]][c] '''+''' 1.0 [[PPI]][c] |
| − | == | + | * With common name(s): |
| + | ** 1.0 coenzyme A[c] '''+''' 1.0 ATP[c] '''+''' 1.0 (R)-2-hydroxystearate[c] '''=>''' 1.0 (R)-2-hydroxy-stearoyl-CoA[c] '''+''' 1.0 AMP[c] '''+''' 1.0 diphosphate[c] | ||
| + | |||
| + | == Genes associated with this reaction == | ||
| + | == Pathways == | ||
| + | == Reconstruction information == | ||
| + | * [[gap-filling]]: | ||
| + | ** [[meneco]]: | ||
| + | *** [[added for gapfilling]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: in pathway=}} | |
| − | + | {{#set: reconstruction category=gap-filling}} | |
| − | + | {{#set: reconstruction tool=meneco}} | |
| − | + | {{#set: reconstruction source=added for gapfilling}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Revision as of 15:39, 10 January 2018
Contents
Reaction RXN66-474-R-2-HYDROXYSTEARATE/ATP/CO-A//CPD-14717/AMP/PPI.48.
- direction:
- LEFT-TO-RIGHT
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1.0 coenzyme A[c] + 1.0 ATP[c] + 1.0 (R)-2-hydroxystearate[c] => 1.0 (R)-2-hydroxy-stearoyl-CoA[c] + 1.0 AMP[c] + 1.0 diphosphate[c]
