Difference between revisions of "CPD-11690"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6538 PWY-6538] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LIPOYL-AMP LIPOYL-AMP] == * smiles: ** C1(SSC(C1)CCCCC(=O)OP(OCC4(C(C(C(N3(C2(=C(C(=NC=N2)N)N=C...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LIPOYL-AMP LIPOYL-AMP] == |
| − | * | + | * smiles: |
| − | ** [ | + | ** C1(SSC(C1)CCCCC(=O)OP(OCC4(C(C(C(N3(C2(=C(C(=NC=N2)N)N=C3)))O4)O)O))([O-])=O) |
| + | * inchi key: | ||
| + | ** InChIKey=QWEGOCJRZOKSOE-ADUAKINBSA-M | ||
* common name: | * common name: | ||
| − | ** | + | ** lipoyl-adenylate |
| + | * molecular weight: | ||
| + | ** 534.518 | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** lipoyl-AMP |
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | * [[RXN-13039]] | |
| − | + | * [[RXN-8655]] | |
| − | + | == Reaction(s) known to produce the compound == | |
| − | == Reaction(s) | + | * [[RXN-8654]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | * LIGAND- | + | * PUBCHEM: |
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245420 25245420] |
| − | * | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=83091 83091] |
| − | {{#set: common name= | + | * LIGAND-CPD: |
| − | {{#set: common name= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C16238 C16238] |
| − | {{#set: | + | * HMDB : HMDB59635 |
| − | {{#set: | + | {{#set: smiles=C1(SSC(C1)CCCCC(=O)OP(OCC4(C(C(C(N3(C2(=C(C(=NC=N2)N)N=C3)))O4)O)O))([O-])=O)}} |
| + | {{#set: inchi key=InChIKey=QWEGOCJRZOKSOE-ADUAKINBSA-M}} | ||
| + | {{#set: common name=lipoyl-adenylate}} | ||
| + | {{#set: molecular weight=534.518 }} | ||
| + | {{#set: common name=lipoyl-AMP}} | ||
| + | {{#set: consumed by=RXN-13039|RXN-8655}} | ||
| + | {{#set: produced by=RXN-8654}} | ||
Revision as of 15:39, 10 January 2018
Contents
Metabolite LIPOYL-AMP
- smiles:
- C1(SSC(C1)CCCCC(=O)OP(OCC4(C(C(C(N3(C2(=C(C(=NC=N2)N)N=C3)))O4)O)O))([O-])=O)
- inchi key:
- InChIKey=QWEGOCJRZOKSOE-ADUAKINBSA-M
- common name:
- lipoyl-adenylate
- molecular weight:
- 534.518
- Synonym(s):
- lipoyl-AMP
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(SSC(C1)CCCCC(=O)OP(OCC4(C(C(C(N3(C2(=C(C(=NC=N2)N)N=C3)))O4)O)O))([O-])=O)" cannot be used as a page name in this wiki.
