Difference between revisions of "PYRIDOXSYN-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHYTOL PHYTOL] == * smiles: ** CC(C)CCCC(C)CCCC(C)CCCC(C)=CCO * inchi key: ** InChIKey=BOTWFXYS...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-381 PWY-381] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-330...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-381 PWY-381] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090] |
− | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2763 TAX-2763] |
− | * | + | |
* common name: | * common name: | ||
− | ** | + | ** nitrate reduction II (assimilatory) |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** nitrate assimilation |
− | + | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[RXN- | + | * '''3''' reaction(s) found |
− | * [[ | + | ** [[FERREDOXIN--NITRITE-REDUCTASE-RXN]] |
− | == Reaction(s) | + | ** [[GLUTAMINESYN-RXN]] |
− | + | ** [[NITRATE-REDUCTASE-NADH-RXN]] | |
+ | == Reaction(s) not found == | ||
+ | * '''0''' reaction(s) not found | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-33090}} | |
− | + | {{#set: taxonomic range=TAX-2763}} | |
− | + | {{#set: common name=nitrate reduction II (assimilatory)}} | |
− | + | {{#set: common name=nitrate assimilation}} | |
− | + | {{#set: reaction found=3}} | |
− | + | {{#set: reaction not found=0}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 16:39, 10 January 2018
Pathway PWY-381
- taxonomic range:
- common name:
- nitrate reduction II (assimilatory)
- Synonym(s):
- nitrate assimilation
Reaction(s) found
- 3 reaction(s) found
Reaction(s) not found
- 0 reaction(s) not found