Difference between revisions of "Tiso gene 284"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACETALD-DEHYDROG-RXN ACETALD-DEHYDROG-RXN] == * direction: ** REVERSIBLE * common name: ** ORF * ec...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-GULONATE L-GULONATE] == * smiles: ** C(O)C(O)C(O)C(O)C(O)C(=O)[O-] * inchi key: ** InChIKey=R...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACETALD-DEHYDROG-RXN ACETALD-DEHYDROG-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-GULONATE L-GULONATE] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** C(O)C(O)C(O)C(O)C(O)C(=O)[O-]
 +
* inchi key:
 +
** InChIKey=RGHNJXZEOKUKBD-QTBDOELSSA-M
 
* common name:
 
* common name:
−
** ORF
+
** L-gulonate
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/1.2.1.10 EC-1.2.1.10]
+
** 195.149   
 
* Synonym(s):
 
* Synonym(s):
 +
** gulonate
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[CO-A]][c] '''+''' 1 [[NAD]][c] '''+''' 1 [[ACETALD]][c] '''<=>''' 1 [[PROTON]][c] '''+''' 1 [[NADH]][c] '''+''' 1 [[ACETYL-COA]][c]
+
* [[RXN-8783]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 coenzyme A[c] '''+''' 1 NAD+[c] '''+''' 1 acetaldehyde[c] '''<=>''' 1 H+[c] '''+''' 1 NADH[c] '''+''' 1 acetyl-CoA[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_2052]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
* [[Tiso_gene_7649]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
== Pathways  ==
+
−
* [[PWY4LZ-257]], superpathway of fermentation (Chlamydomonas reinhardtii): [http://metacyc.org/META/NEW-IMAGE?object=PWY4LZ-257 PWY4LZ-257]
+
−
** '''5''' reactions found over '''13''' reactions in the full pathway
+
−
* [[PWY-5436]], L-threonine degradation IV: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5436 PWY-5436]
+
−
** '''2''' reactions found over '''2''' reactions in the full pathway
+
−
* [[PWY-7180]], 2'-deoxy-&alpha;-D-ribose 1-phosphate degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7180 PWY-7180]
+
−
** '''1''' reactions found over '''3''' reactions in the full pathway
+
−
* [[PWY-5162]], 2-oxopentenoate degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5162 PWY-5162]
+
−
** '''1''' reactions found over '''3''' reactions in the full pathway
+
−
* [[PWY-7085]], triethylamine degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7085 PWY-7085]
+
−
** '''1''' reactions found over '''6''' reactions in the full pathway
+
−
* [[PWY-6587]], pyruvate fermentation to ethanol III: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6587 PWY-6587]
+
−
** '''2''' reactions found over '''3''' reactions in the full pathway
+
−
* [[PHOSPHONOTASE-PWY]], 2-aminoethylphosphonate degradation I: [http://metacyc.org/META/NEW-IMAGE?object=PHOSPHONOTASE-PWY PHOSPHONOTASE-PWY]
+
−
** '''1''' reactions found over '''3''' reactions in the full pathway
+
−
* [[P161-PWY]], acetylene degradation: [http://metacyc.org/META/NEW-IMAGE?object=P161-PWY P161-PWY]
+
−
** '''2''' reactions found over '''5''' reactions in the full pathway
+
−
* [[P122-PWY]], heterolactic fermentation: [http://metacyc.org/META/NEW-IMAGE?object=P122-PWY P122-PWY]
+
−
** '''14''' reactions found over '''18''' reactions in the full pathway
+
−
* [[ETOH-ACETYLCOA-ANA-PWY]], ethanol degradation I: [http://metacyc.org/META/NEW-IMAGE?object=ETOH-ACETYLCOA-ANA-PWY ETOH-ACETYLCOA-ANA-PWY]
+
−
** '''2''' reactions found over '''2''' reactions in the full pathway
+
−
* [[PWY-5480]], pyruvate fermentation to ethanol I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5480 PWY-5480]
+
−
** '''2''' reactions found over '''3''' reactions in the full pathway
+
−
* [[FERMENTATION-PWY]], mixed acid fermentation: [http://metacyc.org/META/NEW-IMAGE?object=FERMENTATION-PWY FERMENTATION-PWY]
+
−
** '''9''' reactions found over '''16''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[creinhardtii]]
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=23288 23288]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6857680 6857680]
−
* LIGAND-RXN:
+
* CHEMSPIDER:
−
** [http://www.genome.jp/dbget-bin/www_bget?R00228 R00228]
+
** [http://www.chemspider.com/Chemical-Structure.5257015.html 5257015]
−
* UNIPROT:
+
* CHEBI:
−
** [http://www.uniprot.org/uniprot/Q52434 Q52434]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=13115 13115]
−
** [http://www.uniprot.org/uniprot/P0A9Q7 P0A9Q7]
+
* METABOLIGHTS : MTBLC13115
−
** [http://www.uniprot.org/uniprot/P77580 P77580]
+
* LIGAND-CPD:
−
** [http://www.uniprot.org/uniprot/P71866 P71866]
+
** [http://www.genome.jp/dbget-bin/www_bget?C00800 C00800]
−
** [http://www.uniprot.org/uniprot/Q52060 Q52060]
+
{{#set: smiles=C(O)C(O)C(O)C(O)C(O)C(=O)[O-]}}
−
** [http://www.uniprot.org/uniprot/Q52016 Q52016]
+
{{#set: inchi key=InChIKey=RGHNJXZEOKUKBD-QTBDOELSSA-M}}
−
** [http://www.uniprot.org/uniprot/O85978 O85978]
+
{{#set: common name=L-gulonate}}
−
{{#set: direction=REVERSIBLE}}
+
{{#set: molecular weight=195.149    }}
−
{{#set: common name=ORF}}
+
{{#set: common name=gulonate}}
−
{{#set: ec number=EC-1.2.1.10}}
+
{{#set: produced by=RXN-8783}}
−
{{#set: gene associated=Tiso_gene_2052|Tiso_gene_7649}}
+
−
{{#set: in pathway=PWY4LZ-257|PWY-5436|PWY-7180|PWY-5162|PWY-7085|PWY-6587|PHOSPHONOTASE-PWY|P161-PWY|P122-PWY|ETOH-ACETYLCOA-ANA-PWY|PWY-5480|FERMENTATION-PWY}}
+
−
{{#set: reconstruction category=orthology}}
+
−
{{#set: reconstruction tool=pantograph}}
+
−
{{#set: reconstruction source=creinhardtii}}
+
−
{{#set: reconstruction category=annotation}}
+
−
{{#set: reconstruction tool=pathwaytools}}
+
−
{{#set: reconstruction source=in-silico_annotation}}
+

Revision as of 15:40, 10 January 2018

Metabolite L-GULONATE

  • smiles:
    • C(O)C(O)C(O)C(O)C(O)C(=O)[O-]
  • inchi key:
    • InChIKey=RGHNJXZEOKUKBD-QTBDOELSSA-M
  • common name:
    • L-gulonate
  • molecular weight:
    • 195.149
  • Synonym(s):
    • gulonate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(O)C(O)C(O)C(O)C(O)C(=O)[O-" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_284&oldid=9958"