Difference between revisions of "1.1.1.271-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-PG 2-PG] == * smiles: ** C(=O)([O-])C(OP(=O)([O-])[O-])CO * inchi key: ** InChIKey=GXIURPTVHJ...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7007 PWY-7007] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7007 PWY-7007] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759] |
− | * | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
− | * | + | |
* common name: | * common name: | ||
− | ** | + | ** methyl ketone biosynthesis (engineered) |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | + | '''3''' reactions found over '''6''' reactions in the full pathway | |
− | + | * [[ACYL-COA-OXIDASE-RXN]] | |
− | * [[ | + | ** 1 associated gene(s): |
− | * [[ | + | *** [[Tiso_gene_18566]] |
− | * [[RXN- | + | ** 2 reconstruction source(s) associated: |
− | * [[RXN- | + | *** [[annotation-in-silico_annotation]] |
+ | *** [[orthology-esiliculosus]] | ||
+ | * [[ENOYL-COA-HYDRAT-RXN]] | ||
+ | ** 3 associated gene(s): | ||
+ | *** [[Tiso_gene_14262]] | ||
+ | *** [[Tiso_gene_16145]] | ||
+ | *** [[Tiso_gene_6885]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | * [[OHACYL-COA-DEHYDROG-RXN]] | ||
+ | ** 6 associated gene(s): | ||
+ | *** [[Tiso_gene_14262]] | ||
+ | *** [[Tiso_gene_14027]] | ||
+ | *** [[Tiso_gene_18838]] | ||
+ | *** [[Tiso_gene_18839]] | ||
+ | *** [[Tiso_gene_14026]] | ||
+ | *** [[Tiso_gene_5857]] | ||
+ | ** 3 reconstruction source(s) associated: | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=BUTYRATE--COA-LIGASE-RXN BUTYRATE--COA-LIGASE-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-13247 RXN-13247] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-13248 RXN-13248] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-2759}} | |
− | + | {{#set: taxonomic range=TAX-2}} | |
− | + | {{#set: common name=methyl ketone biosynthesis (engineered)}} | |
− | + | {{#set: reaction found=3}} | |
− | + | {{#set: total reaction=6}} | |
− | + | {{#set: completion rate=50.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 19:22, 18 March 2018
Pathway PWY-7007
Reaction(s) found
3 reactions found over 6 reactions in the full pathway
- ACYL-COA-OXIDASE-RXN
- 1 associated gene(s):
- 2 reconstruction source(s) associated:
- ENOYL-COA-HYDRAT-RXN
- 3 associated gene(s):
- 1 reconstruction source(s) associated:
- OHACYL-COA-DEHYDROG-RXN
- 6 associated gene(s):
- 3 reconstruction source(s) associated: