Difference between revisions of "1.14.11.18-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-Me-Branched-234-Sat-Fatty-Acyl-CoA 2-Me-Branched-234-Sat-Fatty-Acyl-CoA] == * common name: **...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14876 CPD-14876] == * smiles: ** CC(=O)NC1(=CC([CH]=O)=CC=C([O-])1) * inchi key: ** InChIKe...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14876 CPD-14876] == |
+ | * smiles: | ||
+ | ** CC(=O)NC1(=CC([CH]=O)=CC=C([O-])1) | ||
+ | * inchi key: | ||
+ | ** InChIKey=ODYOPAJBVPISJD-UHFFFAOYSA-M | ||
* common name: | * common name: | ||
− | ** | + | ** 3-acetylamino-4-hydroxybenzaldehyde |
+ | * molecular weight: | ||
+ | ** 178.167 | ||
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[RXN-13871]] | ||
== External links == | == External links == | ||
− | {{#set: common name= | + | * PUBCHEM: |
− | {{#set: produced by= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657664 90657664] |
+ | {{#set: smiles=CC(=O)NC1(=CC([CH]=O)=CC=C([O-])1)}} | ||
+ | {{#set: inchi key=InChIKey=ODYOPAJBVPISJD-UHFFFAOYSA-M}} | ||
+ | {{#set: common name=3-acetylamino-4-hydroxybenzaldehyde}} | ||
+ | {{#set: molecular weight=178.167 }} | ||
+ | {{#set: consumed or produced by=RXN-13871}} |
Revision as of 16:59, 10 January 2018
Contents
Metabolite CPD-14876
- smiles:
- CC(=O)NC1(=CC([CH]=O)=CC=C([O-])1)
- inchi key:
- InChIKey=ODYOPAJBVPISJD-UHFFFAOYSA-M
- common name:
- 3-acetylamino-4-hydroxybenzaldehyde
- molecular weight:
- 178.167
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CC(=O)NC1(=CC([CH]=O)=CC=C([O-])1)" cannot be used as a page name in this wiki.