Difference between revisions of "1.14.11.18-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14876 CPD-14876] == * smiles: ** CC(=O)NC1(=CC([CH]=O)=CC=C([O-])1) * inchi key: ** InChIKe...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6525 PWY-6525] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3568 TAX-35...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6525 PWY-6525] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3568 TAX-3568] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** stellariose and mediose biosynthesis |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** galactosyl-oligosaccharides biosynthesis | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | + | '''1''' reactions found over '''5''' reactions in the full pathway | |
− | == Reaction(s) | + | * [[2.4.1.123-RXN]] |
− | * [[RXN- | + | ** 1 associated gene(s): |
+ | *** [[Tiso_gene_18913]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[orthology-creinhardtii]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=2.4.1.82-RXN 2.4.1.82-RXN] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-11490 RXN-11490] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-11491 RXN-11491] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-11492 RXN-11492] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-3568}} | |
− | + | {{#set: common name=stellariose and mediose biosynthesis}} | |
− | {{#set: | + | {{#set: common name=galactosyl-oligosaccharides biosynthesis}} |
− | {{#set: | + | {{#set: reaction found=1}} |
− | {{#set: common name= | + | {{#set: total reaction=5}} |
− | {{#set: | + | {{#set: completion rate=20.0}} |
− | {{#set: | + |
Revision as of 19:05, 18 March 2018
Pathway PWY-6525
- taxonomic range:
- common name:
- stellariose and mediose biosynthesis
- Synonym(s):
- galactosyl-oligosaccharides biosynthesis
Reaction(s) found
1 reactions found over 5 reactions in the full pathway
- 2.4.1.123-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated: