Difference between revisions of "1.8.4.14-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GAMPG GAMPG] == * direction: ** LEFT-TO-RIGHT * common name: ** GTP:alpha-D-mannose-1-phosphate gua...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11522 CPD-11522] == * smiles: ** CCC=CCC4(C(=O)CCC(CCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=GAMPG GAMPG] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11522 CPD-11522] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CCC=CCC4(C(=O)CCC(CCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)
 +
* inchi key:
 +
** InChIKey=IEENEQSEOWXDQK-JXVDQXHRSA-J
 
* common name:
 
* common name:
−
** GTP:alpha-D-mannose-1-phosphate guanylyltransferase
+
** OPC6-trans-2-enoyl-CoA
 +
* molecular weight:
 +
** 1009.851   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-10704]]
−
** 1.0 [[PROTON]][c] '''+''' 1.0 [[GTP]][c] '''+''' 1.0 [[MANNOSE-1P]][c] '''=>''' 1.0 [[GDP-MANNOSE]][c] '''+''' 1.0 [[PPI]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[RXN-10706]]
−
** 1.0 H+[c] '''+''' 1.0 GTP[c] '''+''' 1.0 α-D-mannose 1-phosphate[c] '''=>''' 1.0 GDP-α-D-mannose[c] '''+''' 1.0 diphosphate[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_14704]]
+
−
** [[pantograph]]-[[creinhardtii]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[creinhardtii]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=GTP:alpha-D-mannose-1-phosphate guanylyltransferase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237321 44237321]
−
{{#set: gene associated=Tiso_gene_14704}}
+
{{#set: smiles=CCC=CCC4(C(=O)CCC(CCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)}}
−
{{#set: in pathway=}}
+
{{#set: inchi key=InChIKey=IEENEQSEOWXDQK-JXVDQXHRSA-J}}
−
{{#set: reconstruction category=orthology}}
+
{{#set: common name=OPC6-trans-2-enoyl-CoA}}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: molecular weight=1009.851    }}
−
{{#set: reconstruction source=creinhardtii}}
+
{{#set: consumed by=RXN-10704}}
 +
{{#set: produced by=RXN-10706}}

Revision as of 18:34, 10 January 2018

Metabolite CPD-11522

  • smiles:
    • CCC=CCC4(C(=O)CCC(CCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)
  • inchi key:
    • InChIKey=IEENEQSEOWXDQK-JXVDQXHRSA-J
  • common name:
    • OPC6-trans-2-enoyl-CoA
  • molecular weight:
    • 1009.851
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCC=CCC4(C(=O)CCC(CCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=1.8.4.14-RXN&oldid=18450"