Difference between revisions of "10-FORMYL-THF"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=HICH HICH] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-hydroxyisobutyryl-CoA hydrolase * S...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=10-FORMYL-THF 10-FORMYL-THF] == * smiles: ** C2([CH](CN(C=O)C1(C=CC(C(=O)NC(C(=O)[O-])CCC([O-])...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=10-FORMYL-THF 10-FORMYL-THF] == |
− | * | + | * smiles: |
− | ** | + | ** C2([CH](CN(C=O)C1(C=CC(C(=O)NC(C(=O)[O-])CCC([O-])=O)=CC=1))NC3(C(=O)NC(N)=NC(N2)=3)) |
* common name: | * common name: | ||
− | ** | + | ** 10-formyl-tetrahydrofolate mono-L-glutamate |
+ | * inchi key: | ||
+ | ** InChIKey=AUFGTPPARQZWDO-YPMHNXCESA-L | ||
+ | * molecular weight: | ||
+ | ** 471.429 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** N10-formyl-tetrahydrofolate mono-L-glutamate | ||
+ | ** N10-formyl-THF mono-L-glutamate | ||
+ | ** N10-formyl-H4F mono-L-glutamate | ||
+ | ** 10-formyl-THF mono-L-glutamate | ||
+ | ** 10-formyl-H4PteGlu1 | ||
+ | ** N10-formyl-H4PteGlu1 | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[FTHFO]] |
− | + | * [[MTHFCx]] | |
− | * | + | * [[R04560]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[FTHFL]] | |
− | == | + | == Reaction(s) of unknown directionality == |
− | + | * [[FPGFTm]] | |
− | * [[ | + | * [[R01655]] |
− | + | * [[FPAIF]] | |
− | == | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * CAS : 2800-34-2 |
− | {{#set: common name= | + | * BIGG : 10fthf |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878370 46878370] |
− | {{#set: | + | * HMDB : HMDB00972 |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00234 C00234] |
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57454 57454] | ||
+ | * METABOLIGHTS : MTBLC57454 | ||
+ | {{#set: smiles=C2([CH](CN(C=O)C1(C=CC(C(=O)NC(C(=O)[O-])CCC([O-])=O)=CC=1))NC3(C(=O)NC(N)=NC(N2)=3))}} | ||
+ | {{#set: common name=10-formyl-tetrahydrofolate mono-L-glutamate}} | ||
+ | {{#set: inchi key=InChIKey=AUFGTPPARQZWDO-YPMHNXCESA-L}} | ||
+ | {{#set: molecular weight=471.429 }} | ||
+ | {{#set: common name=N10-formyl-tetrahydrofolate mono-L-glutamate|N10-formyl-THF mono-L-glutamate|N10-formyl-H4F mono-L-glutamate|10-formyl-THF mono-L-glutamate|10-formyl-H4PteGlu1|N10-formyl-H4PteGlu1}} | ||
+ | {{#set: consumed by=FTHFO|MTHFCx|R04560}} | ||
+ | {{#set: produced by=FTHFL}} | ||
+ | {{#set: reversible reaction associated=FPGFTm|R01655|FPAIF}} |
Latest revision as of 21:11, 21 March 2018
Contents
Metabolite 10-FORMYL-THF
- smiles:
- C2([CH](CN(C=O)C1(C=CC(C(=O)NC(C(=O)[O-])CCC([O-])=O)=CC=1))NC3(C(=O)NC(N)=NC(N2)=3))
- common name:
- 10-formyl-tetrahydrofolate mono-L-glutamate
- inchi key:
- InChIKey=AUFGTPPARQZWDO-YPMHNXCESA-L
- molecular weight:
- 471.429
- Synonym(s):
- N10-formyl-tetrahydrofolate mono-L-glutamate
- N10-formyl-THF mono-L-glutamate
- N10-formyl-H4F mono-L-glutamate
- 10-formyl-THF mono-L-glutamate
- 10-formyl-H4PteGlu1
- N10-formyl-H4PteGlu1
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 2800-34-2
- BIGG : 10fthf
- PUBCHEM:
- HMDB : HMDB00972
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC57454
"C2([CH](CN(C=O)C1(C=CC(C(=O)NC(C(=O)[O-])CCC([O-])=O)=CC=1))NC3(C(=O)NC(N)=NC(N2)=3))" cannot be used as a page name in this wiki.