Difference between revisions of "12-apo-Carotenals"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-glucopyranose-6-phosphate D-glucopyranose-6-phosphate] == * common name: ** D-glucopyranose 6...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-DEHYDROPANTOATE 2-DEHYDROPANTOATE] == * smiles: ** CC(C(=O)C([O-])=O)(CO)C * inchi key: ** In...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-DEHYDROPANTOATE 2-DEHYDROPANTOATE] == |
+ | * smiles: | ||
+ | ** CC(C(=O)C([O-])=O)(CO)C | ||
+ | * inchi key: | ||
+ | ** InChIKey=PKVVTUWHANFMQC-UHFFFAOYSA-M | ||
* common name: | * common name: | ||
− | ** | + | ** 2-dehydropantoate |
+ | * molecular weight: | ||
+ | ** 145.135 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** ketopantoate |
+ | ** 2-ketopantoate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[2-DEHYDROPANTOATE-REDUCT-RXN]] |
− | + | ||
− | + | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[MTMOHT]] |
− | * [[ | + | * [[RXN-15635]] |
− | * [[ | + | * [[R01226]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | * [[ | + | * [[3-CH3-2-OXOBUTANOATE-OH-CH3-XFER-RXN]] |
− | + | * [[KETOPANTOALDOLASE-RXN]] | |
− | * [[ | + | |
− | + | ||
== External links == | == External links == | ||
− | {{#set: common name= | + | * DRUGBANK : DB03795 |
− | {{#set: common name= | + | * PUBCHEM: |
− | {{#set: consumed by= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=16755619 16755619] |
− | {{#set: produced by= | + | * LIGAND-CPD: |
− | {{#set: consumed or produced by= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00966 C00966] |
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.14649571.html 14649571] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=11561 11561] | ||
+ | * BIGG : 2dhp | ||
+ | {{#set: smiles=CC(C(=O)C([O-])=O)(CO)C}} | ||
+ | {{#set: inchi key=InChIKey=PKVVTUWHANFMQC-UHFFFAOYSA-M}} | ||
+ | {{#set: common name=2-dehydropantoate}} | ||
+ | {{#set: molecular weight=145.135 }} | ||
+ | {{#set: common name=ketopantoate|2-ketopantoate}} | ||
+ | {{#set: consumed by=2-DEHYDROPANTOATE-REDUCT-RXN}} | ||
+ | {{#set: produced by=MTMOHT|RXN-15635|R01226}} | ||
+ | {{#set: consumed or produced by=3-CH3-2-OXOBUTANOATE-OH-CH3-XFER-RXN|KETOPANTOALDOLASE-RXN}} |
Revision as of 17:20, 10 January 2018
Contents
Metabolite 2-DEHYDROPANTOATE
- smiles:
- CC(C(=O)C([O-])=O)(CO)C
- inchi key:
- InChIKey=PKVVTUWHANFMQC-UHFFFAOYSA-M
- common name:
- 2-dehydropantoate
- molecular weight:
- 145.135
- Synonym(s):
- ketopantoate
- 2-ketopantoate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- DRUGBANK : DB03795
- PUBCHEM:
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- BIGG : 2dhp
"CC(C(=O)C([O-])=O)(CO)C" cannot be used as a page name in this wiki.