Difference between revisions of "131-OXO-MAGNESIUM-PROTOPORPHYRIN-IX-13-M"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=EGMEACPR EGMEACPR] == * direction: ** LEFT-TO-RIGHT * common name: ** Enoylglutaryl-[ACP] methyl es...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=131-OXO-MAGNESIUM-PROTOPORPHYRIN-IX-13-M 131-OXO-MAGNESIUM-PROTOPORPHYRIN-IX-13-M] == * smiles:...")
 
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=EGMEACPR EGMEACPR] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=131-OXO-MAGNESIUM-PROTOPORPHYRIN-IX-13-M 131-OXO-MAGNESIUM-PROTOPORPHYRIN-IX-13-M] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=N([Mg]35(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C6(C(C)=C(C(=O)CC(=O)OC)C(N56)=C7))))8))))
 
* common name:
 
* common name:
−
** Enoylglutaryl-[ACP] methyl ester reductase
+
** 131-oxo-magnesium-protoporphyrin IX 13-monomethyl ester
 +
* molecular weight:
 +
** 611.959   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-5284]]
−
** 1.0 [[NADPH]][m] '''+''' 1.0 [[PROTON]][m] '''+''' 1.0 [[Enoylglutaryl-ACP-methyl-esters]][m] '''=>''' 1.0 [[Glutaryl-ACP-methyl-esters]][m] '''+''' 1.0 [[NADP]][m]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[RXN-5283]]
−
** 1.0 NADPH[m] '''+''' 1.0 H+[m] '''+''' 1.0 an enoylglutaryl-[acp] methyl ester[m] '''=>''' 1.0 a glutaryl-[acp] methyl ester[m] '''+''' 1.0 NADP+[m]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* Gene: [[Tiso_gene_10778]]
+
−
** Source: [[orthology-creinhardtii]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-creinhardtii]]
+
−
*** Tool: [[pantograph]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=Enoylglutaryl-[ACP] methyl ester reductase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658440 90658440]
−
{{#set: gene associated=Tiso_gene_10778}}
+
* CHEBI:
−
{{#set: in pathway=}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60490 60490]
−
{{#set: reconstruction category=orthology}}
+
* LIGAND-CPD:
−
{{#set: reconstruction source=orthology-creinhardtii}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C11830 C11830]
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: smiles=C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=N([Mg]35(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C6(C(C)=C(C(=O)CC(=O)OC)C(N56)=C7))))8))))}}
 +
{{#set: common name=131-oxo-magnesium-protoporphyrin IX 13-monomethyl ester}}
 +
{{#set: molecular weight=611.959    }}
 +
{{#set: consumed by=RXN-5284}}
 +
{{#set: produced by=RXN-5283}}

Latest revision as of 21:25, 21 March 2018

Metabolite 131-OXO-MAGNESIUM-PROTOPORPHYRIN-IX-13-M

  • smiles:
    • C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=N([Mg]35(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C6(C(C)=C(C(=O)CC(=O)OC)C(N56)=C7))))8))))
  • common name:
    • 131-oxo-magnesium-protoporphyrin IX 13-monomethyl ester
  • molecular weight:
    • 611.959
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C=CC2(C(C)=C4(C=C8(C(C)=C(CCC(=O)[O-])C7(=N([Mg]35(N1(=C(C(C=C)=C(C)C1=CC=2N34)C=C6(C(C)=C(C(=O)CC(=O)OC)C(N56)=C7))))8))))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=131-OXO-MAGNESIUM-PROTOPORPHYRIN-IX-13-M&oldid=48621"