Difference between revisions of "16S-rRNA-N2-methylguanine966"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2744 CPD-2744] == * smiles: ** C1(CC[CH]([N+](C)1)C3(C=[N+](C2(C(C(C(C(O2)C([O-])=O)O)O)O))...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=16S-rRNA-N2-methylguanine966 16S-rRNA-N2-methylguanine966] == * common name: ** an N2-methylgua...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2744 CPD-2744] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=16S-rRNA-N2-methylguanine966 16S-rRNA-N2-methylguanine966] ==
* smiles:
+
** C1(CC[CH]([N+](C)1)C3(C=[N+](C2(C(C(C(C(O2)C([O-])=O)O)O)O))C=CC=3))
+
 
* common name:
 
* common name:
** nicotine-glucuronide
+
** an N2-methylguanine966 in 16S rRNA
* inchi key:
+
** InChIKey=SAWAIULJDYFLPD-SOAFEQHCSA-O
+
* molecular weight:
+
** 339.367   
+
 
* Synonym(s):
 
* Synonym(s):
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN66-83]]
+
* [[RXN0-6515]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=an N2-methylguanine966 in 16S rRNA}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820524 91820524]
+
{{#set: produced by=RXN0-6515}}
* HMDB : HMDB01272
+
{{#set: smiles=C1(CC[CH]([N+](C)1)C3(C=[N+](C2(C(C(C(C(O2)C([O-])=O)O)O)O))C=CC=3))}}
+
{{#set: common name=nicotine-glucuronide}}
+
{{#set: inchi key=InChIKey=SAWAIULJDYFLPD-SOAFEQHCSA-O}}
+
{{#set: molecular weight=339.367    }}
+
{{#set: produced by=RXN66-83}}
+

Latest revision as of 20:43, 21 March 2018

Metabolite 16S-rRNA-N2-methylguanine966

  • common name:
    • an N2-methylguanine966 in 16S rRNA
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links