Difference between revisions of "16S-rRNA-N3-methyluracil1498"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-CYANOPYRIDINE 3-CYANOPYRIDINE] == * smiles: ** C(C1(=CN=CC=C1))#N * inchi key: ** InChIKey=GZ...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=16S-rRNA-N3-methyluracil1498 16S-rRNA-N3-methyluracil1498] == * common name: ** an N3-methylura...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-CYANOPYRIDINE 3-CYANOPYRIDINE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=16S-rRNA-N3-methyluracil1498 16S-rRNA-N3-methyluracil1498] ==
* smiles:
+
** C(C1(=CN=CC=C1))#N
+
* inchi key:
+
** InChIKey=GZPHSAQLYPIAIN-UHFFFAOYSA-N
+
 
* common name:
 
* common name:
** 3-cyanopyridine
+
** an N3-methyluracil1498 in 16S rRNA
* molecular weight:
+
** 104.111   
+
 
* Synonym(s):
 
* Synonym(s):
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[R313-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-11598]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* CAS : 100-54-9
+
{{#set: common name=an N3-methyluracil1498 in 16S rRNA}}
* PUBCHEM:
+
{{#set: produced by=RXN-11598}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=79 79]
+
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.78.html 78]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=86556 86556]
+
* NCI:
+
** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=17558 17558]
+
{{#set: smiles=C(C1(=CN=CC=C1))#N}}
+
{{#set: inchi key=InChIKey=GZPHSAQLYPIAIN-UHFFFAOYSA-N}}
+
{{#set: common name=3-cyanopyridine}}
+
{{#set: molecular weight=104.111    }}
+
{{#set: consumed by=R313-RXN}}
+

Latest revision as of 20:25, 21 March 2018

Metabolite 16S-rRNA-N3-methyluracil1498

  • common name:
    • an N3-methyluracil1498 in 16S rRNA
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links