Difference between revisions of "1TRANSKETO-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-602 CPD-602] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)NC2(=C(N)C(=O)NC(=O)N2)) *...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10059 RXN-10059] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-oxoacyl-synthase * ec num...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-602 CPD-602] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10059 RXN-10059] ==
−
* smiles:
+
* direction:
−
** C(OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)NC2(=C(N)C(=O)NC(=O)N2))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=LZEXYCAGPMYXLX-UMMCILCDSA-L
+
 
* common name:
 
* common name:
−
** 5-amino-6-(5-phospho-D-ribosylamino)uracil
+
** 3-oxoacyl-synthase
−
* molecular weight:
+
* ec number:
−
** 352.197   
+
** [http://enzyme.expasy.org/EC/2.3.1.41 EC-2.3.1.41]
 
* Synonym(s):
 
* Synonym(s):
−
** 5-amino-6-(ribosylamino)-2,4-(1H,3H)-pyrimidinedione 5'-phosphate
 
−
** 5-amino-6-(5'-phosphoribosylamino)uracil
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RIBOFLAVINSYNREDUC-RXN]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[PROTON]][c] '''+''' 1 [[MALONYL-COA]][c] '''+''' 1 [[Lignoceroyl-ACPs]][c] '''=>''' 1 [[3-oxo-cerotoyl-ACPs]][c] '''+''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[CO-A]][c]
−
* [[RIBOFLAVINSYNDEAM-RXN]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 H+[c] '''+''' 1 malonyl-CoA[c] '''+''' 1 a lignoceroyl-[acp][c] '''=>''' 1 a 3-oxo-cerotoyl-[acp][c] '''+''' 1 CO2[c] '''+''' 1 coenzyme A[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_15991]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_19302]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_14485]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_5939]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-6113]], superpathway of mycolate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6113 PWY-6113]
 +
** '''8''' reactions found over '''12''' reactions in the full pathway
 +
* [[PWYG-321]], mycolate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWYG-321 PWYG-321]
 +
** '''86''' reactions found over '''182''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245199 25245199]
+
{{#set: common name=3-oxoacyl-synthase}}
−
* CHEBI:
+
{{#set: ec number=EC-2.3.1.41}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58453 58453]
+
{{#set: gene associated=Tiso_gene_15991|Tiso_gene_19302|Tiso_gene_14485|Tiso_gene_5939}}
−
* BIGG : 5apru
+
{{#set: in pathway=PWY-6113|PWYG-321}}
−
* LIGAND-CPD:
+
{{#set: reconstruction category=orthology|annotation}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01268 C01268]
+
{{#set: reconstruction source=annotation-experimental_annotation|annotation-in-silico_annotation|orthology-esiliculosus}}
−
{{#set: smiles=C(OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)NC2(=C(N)C(=O)NC(=O)N2))}}
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
−
{{#set: inchi key=InChIKey=LZEXYCAGPMYXLX-UMMCILCDSA-L}}
+
−
{{#set: common name=5-amino-6-(5-phospho-D-ribosylamino)uracil}}
+
−
{{#set: molecular weight=352.197    }}
+
−
{{#set: common name=5-amino-6-(ribosylamino)-2,4-(1H,3H)-pyrimidinedione 5'-phosphate|5-amino-6-(5'-phosphoribosylamino)uracil}}
+
−
{{#set: consumed by=RIBOFLAVINSYNREDUC-RXN}}
+
−
{{#set: produced by=RIBOFLAVINSYNDEAM-RXN}}
+

Revision as of 16:35, 21 March 2018

Reaction RXN-10059

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 3-oxoacyl-synthase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6113, superpathway of mycolate biosynthesis: PWY-6113
    • 8 reactions found over 12 reactions in the full pathway
  • PWYG-321, mycolate biosynthesis: PWYG-321
    • 86 reactions found over 182 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=1TRANSKETO-RXN&oldid=35049"