Difference between revisions of "2-3-DIHYDRODIPICOLINATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=EIF5A-LYSINE EIF5A-LYSINE] == * common name: ** an [eIF5A-precursor]-lysine * Synonym(s): ** an...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-3-DIHYDRODIPICOLINATE 2-3-DIHYDRODIPICOLINATE] == * smiles: ** C1(CC(N=C(C=1)C(=O)[O-])C(=O)[...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-3-DIHYDRODIPICOLINATE 2-3-DIHYDRODIPICOLINATE] == |
| + | * smiles: | ||
| + | ** C1(CC(N=C(C=1)C(=O)[O-])C(=O)[O-]) | ||
* common name: | * common name: | ||
| − | ** | + | ** (S)-2,3-dihydrodipicolinate |
| + | * inchi key: | ||
| + | ** InChIKey=UWOCFOFVIBZJGH-YFKPBYRVSA-L | ||
| + | * molecular weight: | ||
| + | ** 167.121 | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 2,3-di-H-dipicolinate |
| − | ** | + | ** L-2,3-dihydrodipicolinate |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[R02292]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460228 5460228] |
| − | {{#set: | + | * CHEMSPIDER: |
| + | ** [http://www.chemspider.com/Chemical-Structure.4573840.html 4573840] | ||
| + | * HMDB : HMDB12247 | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=30620 30620] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C03340 C03340] | ||
| + | {{#set: smiles=C1(CC(N=C(C=1)C(=O)[O-])C(=O)[O-])}} | ||
| + | {{#set: common name=(S)-2,3-dihydrodipicolinate}} | ||
| + | {{#set: inchi key=InChIKey=UWOCFOFVIBZJGH-YFKPBYRVSA-L}} | ||
| + | {{#set: molecular weight=167.121 }} | ||
| + | {{#set: common name=2,3-di-H-dipicolinate|L-2,3-dihydrodipicolinate}} | ||
| + | {{#set: produced by=R02292}} | ||
Latest revision as of 20:27, 21 March 2018
Contents
Metabolite 2-3-DIHYDRODIPICOLINATE
- smiles:
- C1(CC(N=C(C=1)C(=O)[O-])C(=O)[O-])
- common name:
- (S)-2,3-dihydrodipicolinate
- inchi key:
- InChIKey=UWOCFOFVIBZJGH-YFKPBYRVSA-L
- molecular weight:
- 167.121
- Synonym(s):
- 2,3-di-H-dipicolinate
- L-2,3-dihydrodipicolinate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(CC(N=C(C=1)C(=O)[O-])C(=O)[O-])" cannot be used as a page name in this wiki.
