Difference between revisions of "2-3-DIHYDRODIPICOLINATE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10062 RXN-10062] == * direction: ** LEFT-TO-RIGHT * common name: ** trans-hexacos-2-enoyl-[acp]...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-3-DIHYDRODIPICOLINATE 2-3-DIHYDRODIPICOLINATE] == * smiles: ** C1(CC(N=C(C=1)C(=O)[O-])C(=O)[...")
 
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10062 RXN-10062] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-3-DIHYDRODIPICOLINATE 2-3-DIHYDRODIPICOLINATE] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C1(CC(N=C(C=1)C(=O)[O-])C(=O)[O-])
 
* common name:
 
* common name:
−
** trans-hexacos-2-enoyl-[acp] reductase
+
** (S)-2,3-dihydrodipicolinate
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/1.3.1.9 EC-1.3.1.9]
+
** InChIKey=UWOCFOFVIBZJGH-YFKPBYRVSA-L
 +
* molecular weight:
 +
** 167.121   
 
* Synonym(s):
 
* Synonym(s):
 +
** 2,3-di-H-dipicolinate
 +
** L-2,3-dihydrodipicolinate
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[NADH]][c] '''+''' 1 [[Trans-D2-hexacos-2-enoyl-ACPs]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[Cerotoyl-ACPs]][c] '''+''' 1 [[NAD]][c]
+
* [[R02292]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 NADH[c] '''+''' 1 a trans-hexacos-2-enoyl-[acp][c] '''+''' 1 H+[c] '''=>''' 1 a cerotoyl-[acp][c] '''+''' 1 NAD+[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* Gene: [[Tiso_gene_10778]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
== Pathways  ==
+
−
* [[PWY-6113]], superpathway of mycolate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6113 PWY-6113]
+
−
** '''8''' reactions found over '''12''' reactions in the full pathway
+
−
* [[PWYG-321]], mycolate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWYG-321 PWYG-321]
+
−
** '''86''' reactions found over '''182''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
*** Tool: [[pantograph]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=trans-hexacos-2-enoyl-[acp] reductase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5460228 5460228]
−
{{#set: ec number=EC-1.3.1.9}}
+
* CHEMSPIDER:
−
{{#set: gene associated=Tiso_gene_10778}}
+
** [http://www.chemspider.com/Chemical-Structure.4573840.html 4573840]
−
{{#set: in pathway=PWY-6113|PWYG-321}}
+
* HMDB : HMDB12247
−
{{#set: reconstruction category=orthology}}
+
* CHEBI:
−
{{#set: reconstruction source=orthology-esiliculosus}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=30620 30620]
−
{{#set: reconstruction tool=pantograph}}
+
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C03340 C03340]
 +
{{#set: smiles=C1(CC(N=C(C=1)C(=O)[O-])C(=O)[O-])}}
 +
{{#set: common name=(S)-2,3-dihydrodipicolinate}}
 +
{{#set: inchi key=InChIKey=UWOCFOFVIBZJGH-YFKPBYRVSA-L}}
 +
{{#set: molecular weight=167.121    }}
 +
{{#set: common name=2,3-di-H-dipicolinate|L-2,3-dihydrodipicolinate}}
 +
{{#set: produced by=R02292}}

Latest revision as of 20:27, 21 March 2018

Metabolite 2-3-DIHYDRODIPICOLINATE

  • smiles:
    • C1(CC(N=C(C=1)C(=O)[O-])C(=O)[O-])
  • common name:
    • (S)-2,3-dihydrodipicolinate
  • inchi key:
    • InChIKey=UWOCFOFVIBZJGH-YFKPBYRVSA-L
  • molecular weight:
    • 167.121
  • Synonym(s):
    • 2,3-di-H-dipicolinate
    • L-2,3-dihydrodipicolinate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C1(CC(N=C(C=1)C(=O)[O-])C(=O)[O-])" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=2-3-DIHYDRODIPICOLINATE&oldid=41683"