Difference between revisions of "2-KETOGLUTARATE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15675 CPD-15675] == * smiles: ** CCCCCCC=CCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(...")
 
(Created page with "Category:Gene == Gene Tiso_gene_13303 == * left end position: ** 3623 * transcription direction: ** POSITIVE * right end position: ** 6215 * centisome position: ** 56.7157...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15675 CPD-15675] ==
+
== Gene Tiso_gene_13303 ==
−
* smiles:
+
* left end position:
−
** CCCCCCC=CCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 3623
−
* inchi key:
+
* transcription direction:
−
** InChIKey=OOSDLBAXVXKFIB-BJBRNGJVSA-J
+
** POSITIVE
−
* common name:
+
* right end position:
−
** 2-trans-6-trans-tridecadienoyl-CoA
+
** 6215
−
* molecular weight:
+
* centisome position:
−
** 955.803    
+
** 56.715714    
 
* Synonym(s):
 
* Synonym(s):
−
** 2E, 6E-tridecadienoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[DNA-DIRECTED-DNA-POLYMERASE-RXN]]
−
* [[RXN-14785]]
+
** in-silico_annotation
−
== Reaction(s) of unknown directionality ==
+
***ec-number
 +
** experimental_annotation
 +
***ec-number
 +
** [[pantograph]]-[[esiliculosus]]
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=3623}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658431 90658431]
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: smiles=CCCCCCC=CCCC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: right end position=6215}}
−
{{#set: inchi key=InChIKey=OOSDLBAXVXKFIB-BJBRNGJVSA-J}}
+
{{#set: centisome position=56.715714   }}
−
{{#set: common name=2-trans-6-trans-tridecadienoyl-CoA}}
+
{{#set: reaction associated=DNA-DIRECTED-DNA-POLYMERASE-RXN}}
−
{{#set: molecular weight=955.803   }}
+
−
{{#set: common name=2E, 6E-tridecadienoyl-CoA}}
+
−
{{#set: produced by=RXN-14785}}
+

Revision as of 18:05, 10 January 2018

Gene Tiso_gene_13303

  • left end position:
    • 3623
  • transcription direction:
    • POSITIVE
  • right end position:
    • 6215
  • centisome position:
    • 56.715714
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=2-KETOGLUTARATE&oldid=16110"