Difference between revisions of "2-OH-3-Methyl-Saturated-Fatty-Acyl-CoA"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CHLOROPHYLLIDE-A CHLOROPHYLLIDE-A] == * smiles: ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-OH-3-Methyl-Saturated-Fatty-Acyl-CoA 2-OH-3-Methyl-Saturated-Fatty-Acyl-CoA] == * common name...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CHLOROPHYLLIDE-A CHLOROPHYLLIDE-A] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-OH-3-Methyl-Saturated-Fatty-Acyl-CoA 2-OH-3-Methyl-Saturated-Fatty-Acyl-CoA] ==
* smiles:
+
** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))
+
 
* common name:
 
* common name:
** chlorophyllide a
+
** a 2-hydroxy-3-methyl-branched 2,3,4-saturated fatty acyl-CoA
* molecular weight:
+
** 612.967   
+
 
* Synonym(s):
 
* Synonym(s):
** chlorophyllide
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-7663]]
 
* [[RXN-7676]]
 
* [[RXN-13398]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-5286]]
+
* [[RXN66-470]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[RXN1F-10]]
 
* [[RXN1F-66]]
 
 
== External links  ==
 
== External links  ==
* CAS : 14897-06-4
+
{{#set: common name=a 2-hydroxy-3-methyl-branched 2,3,4-saturated fatty acyl-CoA}}
* PUBCHEM:
+
{{#set: produced by=RXN66-470}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54729368 54729368]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=83348 83348]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C02139 C02139]
+
{{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)[O-])C5(=N([Mg]36(N1(=C(C(CC)=C(C)C1=CC=2N34)C=C7(C(C)=C8(C(=O)[C-](C(OC)=O)C5=C(N67)8)))))9))))}}
+
{{#set: common name=chlorophyllide a}}
+
{{#set: molecular weight=612.967    }}
+
{{#set: common name=chlorophyllide}}
+
{{#set: consumed by=RXN-7663|RXN-7676|RXN-13398}}
+
{{#set: produced by=RXN-5286}}
+
{{#set: consumed or produced by=RXN1F-10|RXN1F-66}}
+

Latest revision as of 20:29, 21 March 2018

Metabolite 2-OH-3-Methyl-Saturated-Fatty-Acyl-CoA

  • common name:
    • a 2-hydroxy-3-methyl-branched 2,3,4-saturated fatty acyl-CoA
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links