Difference between revisions of "2.3.1.179-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10697 RXN-10697] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11740 CPD-11740] == * smiles: ** C(P(C([O-])=O)([O-])=O)C(=O)C(=O)[O-] * common name: ** ca...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10697 RXN-10697] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11740 CPD-11740] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(P(C([O-])=O)([O-])=O)C(=O)C(=O)[O-]
−
* ec number:
+
* common name:
−
** [http://enzyme.expasy.org/EC/4.2.1.17 EC-4.2.1.17]
+
** carboxyphosphinopyruvate
 +
* inchi key:
 +
** InChIKey=YTKWPNBYPYOWCP-UHFFFAOYSA-K
 +
* molecular weight:
 +
** 193.029   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-10828]]
−
** 1 [[CPD-11518]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[CPD-11519]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[RXN-10827]]
−
** 1 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octa-2-enoyl-CoA[c] '''+''' 1 H2O[c] '''=>''' 1 OPC8-3-hydroxyacyl-CoA[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_16145]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
* [[Tiso_gene_6885]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
* [[Tiso_gene_14262]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways  ==
+
−
* [[PWY-735]], jasmonic acid biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-735 PWY-735]
+
−
** '''15''' reactions found over '''19''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
*** Tool: [[pantograph]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: ec number=EC-4.2.1.17}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45479707 45479707]
−
{{#set: gene associated=Tiso_gene_16145|Tiso_gene_6885|Tiso_gene_14262}}
+
{{#set: smiles=C(P(C([O-])=O)([O-])=O)C(=O)C(=O)[O-]}}
−
{{#set: in pathway=PWY-735}}
+
{{#set: common name=carboxyphosphinopyruvate}}
−
{{#set: reconstruction category=orthology}}
+
{{#set: inchi key=InChIKey=YTKWPNBYPYOWCP-UHFFFAOYSA-K}}
−
{{#set: reconstruction source=orthology-esiliculosus}}
+
{{#set: molecular weight=193.029    }}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: consumed by=RXN-10828}}
 +
{{#set: produced by=RXN-10827}}

Revision as of 16:51, 21 March 2018

Metabolite CPD-11740

  • smiles:
    • C(P(C([O-])=O)([O-])=O)C(=O)C(=O)[O-]
  • common name:
    • carboxyphosphinopyruvate
  • inchi key:
    • InChIKey=YTKWPNBYPYOWCP-UHFFFAOYSA-K
  • molecular weight:
    • 193.029
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(P(C([O-])=O)([O-])=O)C(=O)C(=O)[O-" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=2.3.1.179-RXN&oldid=36830"