Difference between revisions of "2.3.1.179-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11740 CPD-11740] == * smiles: ** C(P(C([O-])=O)([O-])=O)C(=O)C(=O)[O-] * common name: ** ca...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.3.1.179-RXN 2.3.1.179-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-oxoacyl-(acyl-car...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.3.1.179-RXN 2.3.1.179-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
* common name: | * common name: | ||
− | ** | + | ** 3-oxoacyl-(acyl-carrier-protein)_synthase |
− | * | + | ** ORF |
− | * | + | * ec number: |
− | * | + | ** [http://enzyme.expasy.org/EC/2.3.1.179 EC-2.3.1.179] |
− | ** | + | |
* Synonym(s): | * Synonym(s): | ||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[PROTON]][c] '''+''' 1 [[MALONYL-ACP]][c] '''+''' 1 [[Palmitoleoyl-ACPs]][c] '''=>''' 1 [[3-oxo-cis-vaccenoyl-ACPs]][c] '''+''' 1 [[CARBON-DIOXIDE]][c] '''+''' 1 [[ACP]][c] |
− | * [[ | + | * With common name(s): |
− | == | + | ** 1 H+[c] '''+''' 1 a malonyl-[acp][c] '''+''' 1 a palmitoleoyl-[acp][c] '''=>''' 1 a 3-oxo-cis-vacc-11-enoyl-[acp][c] '''+''' 1 CO2[c] '''+''' 1 a holo-[acyl-carrier protein][c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_19302]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_14485]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_19303]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | == Pathways == | ||
+ | * [[PWY-5973]], cis-vaccenate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5973 PWY-5973] | ||
+ | ** '''4''' reactions found over '''5''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=3-oxoacyl-(acyl-carrier-protein)_synthase}} | |
− | {{#set: | + | {{#set: common name=ORF}} |
− | {{#set: common name= | + | {{#set: ec number=EC-2.3.1.179}} |
− | {{#set: | + | {{#set: gene associated=Tiso_gene_19302|Tiso_gene_14485|Tiso_gene_19303}} |
− | {{#set: | + | {{#set: in pathway=PWY-5973}} |
− | {{#set: | + | {{#set: reconstruction category=annotation}} |
− | {{#set: | + | {{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation}} |
+ | {{#set: reconstruction tool=pathwaytools}} |
Latest revision as of 21:09, 21 March 2018
Contents
Reaction 2.3.1.179-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- 3-oxoacyl-(acyl-carrier-protein)_synthase
- ORF
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 PROTON[c] + 1 MALONYL-ACP[c] + 1 Palmitoleoyl-ACPs[c] => 1 3-oxo-cis-vaccenoyl-ACPs[c] + 1 CARBON-DIOXIDE[c] + 1 ACP[c]
- With common name(s):
- 1 H+[c] + 1 a malonyl-[acp][c] + 1 a palmitoleoyl-[acp][c] => 1 a 3-oxo-cis-vacc-11-enoyl-[acp][c] + 1 CO2[c] + 1 a holo-[acyl-carrier protein][c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_19302
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-experimental_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_14485
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-experimental_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_19303
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
Pathways
- PWY-5973, cis-vaccenate biosynthesis: PWY-5973
- 4 reactions found over 5 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-experimental_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation