Difference between revisions of "2.5.1.39-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11135 RXN-11135] == * direction: ** REVERSIBLE * common name: ** dna_helicase * ec number: ** [...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12365 CPD-12365] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C(=O)NC2(C(=O)NC(N)=NC=...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11135 RXN-11135] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12365 CPD-12365] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C(=O)NC2(C(=O)NC(N)=NC=23)))
 
* common name:
 
* common name:
−
** dna_helicase
+
** 8-oxo-dGMP
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/3.6.4.12 EC-3.6.4.12]
+
** InChIKey=AQIVLFLYHYFRKU-VPENINKCSA-L
 +
* molecular weight:
 +
** 361.207   
 
* Synonym(s):
 
* Synonym(s):
 +
** 8-oxo-7,8-dihydro-2'-dGMP
 +
** 8-oxo-7,8-dihydro-2'-deoxyguanosine 5'-monophosphate
 +
** 8-oxo-deoxyguanosine-monophosphate
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[Double-helix-DNA]][c] '''+''' 1 [[WATER]][c] '''+''' 1 [[ATP]][c] '''<=>''' 1 [[Unwound-DNA]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[Pi]][c] '''+''' 1 [[ADP]][c]
+
== Reaction(s) of unknown directionality ==
−
* With common name(s):
+
* [[RXN-14205]]
−
** 1 a double-helix DNA[c] '''+''' 1 H2O[c] '''+''' 1 ATP[c] '''<=>''' 1 an unwound double-stranded DNA[c] '''+''' 1 H+[c] '''+''' 1 phosphate[c] '''+''' 1 ADP[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_7081]]
+
−
** IN-SILICO_ANNOTATION
+
−
***AUTOMATED-NAME-MATCH
+
−
* [[Tiso_gene_4087]]
+
−
** IN-SILICO_ANNOTATION
+
−
***AUTOMATED-NAME-MATCH
+
−
* [[Tiso_gene_4088]]
+
−
** IN-SILICO_ANNOTATION
+
−
***AUTOMATED-NAME-MATCH
+
−
* [[Tiso_gene_1799]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
* [[Tiso_gene_1324]]
+
−
** IN-SILICO_ANNOTATION
+
−
***AUTOMATED-NAME-MATCH
+
−
* [[Tiso_gene_7734]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-esiliculosus]]
+
−
*** Tool: [[pantograph]]
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=REVERSIBLE}}
+
* PUBCHEM:
−
{{#set: common name=dna_helicase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173535 46173535]
−
{{#set: ec number=EC-3.6.4.12}}
+
* CHEBI:
−
{{#set: gene associated=Tiso_gene_7081|Tiso_gene_4087|Tiso_gene_4088|Tiso_gene_1799|Tiso_gene_1324|Tiso_gene_7734}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=63224 63224]
−
{{#set: in pathway=}}
+
{{#set: smiles=C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C(=O)NC2(C(=O)NC(N)=NC=23)))}}
−
{{#set: reconstruction category=orthology|annotation}}
+
{{#set: common name=8-oxo-dGMP}}
−
{{#set: reconstruction source=annotation-in-silico_annotation|orthology-esiliculosus}}
+
{{#set: inchi key=InChIKey=AQIVLFLYHYFRKU-VPENINKCSA-L}}
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
+
{{#set: molecular weight=361.207    }}
 +
{{#set: common name=8-oxo-7,8-dihydro-2'-dGMP|8-oxo-7,8-dihydro-2'-deoxyguanosine 5'-monophosphate|8-oxo-deoxyguanosine-monophosphate}}
 +
{{#set: reversible reaction associated=RXN-14205}}

Revision as of 17:06, 21 March 2018

Metabolite CPD-12365

  • smiles:
    • C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C(=O)NC2(C(=O)NC(N)=NC=23)))
  • common name:
    • 8-oxo-dGMP
  • inchi key:
    • InChIKey=AQIVLFLYHYFRKU-VPENINKCSA-L
  • molecular weight:
    • 361.207
  • Synonym(s):
    • 8-oxo-7,8-dihydro-2'-dGMP
    • 8-oxo-7,8-dihydro-2'-deoxyguanosine 5'-monophosphate
    • 8-oxo-deoxyguanosine-monophosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(OP(=O)([O-])[O-])C1(OC(CC(O)1)N3(C(=O)NC2(C(=O)NC(N)=NC=23)))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=2.5.1.39-RXN&oldid=38825"