Difference between revisions of "2C-METH-D-ERYTHRITOL-CYCLODIPHOSPHATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-DEHYDRO-SHIKIMATE 3-DEHYDRO-SHIKIMATE] == * smiles: ** C([O-])(=O)C1(=CC(=O)C(O)C(O)C1) * inc...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-649 CPD-649] == * smiles: ** CCCCCCCCCCCCCCCC(C(COP([O-])(=O)[O-])[N+])O * common name: **...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-649 CPD-649] == |
* smiles: | * smiles: | ||
− | ** C([O-])(=O) | + | ** CCCCCCCCCCCCCCCC(C(COP([O-])(=O)[O-])[N+])O |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** sphinganine 1-phosphate |
+ | * inchi key: | ||
+ | ** InChIKey=YHEDRJPUIRMZMP-ZWKOTPCHSA-M | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 380.484 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** dihydrosphingosine 1-phosphate |
− | ** | + | ** DHS-1-P |
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[SPHINGANINE-1-PHOSPHATE-ALDOLASE-RXN]] |
+ | * [[SGPL11]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[SPHINGANINE-KINASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
== External links == | == External links == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
* LIGAND-CPD: | * LIGAND-CPD: | ||
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01120 C01120] |
− | {{#set: smiles=C([O-])(=O) | + | * HMDB : HMDB01383 |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57939 57939] |
− | {{#set: molecular weight= | + | * METABOLIGHTS : MTBLC57939 |
− | {{#set: common name= | + | * PUBCHEM: |
− | {{#set: consumed by= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878432 46878432] |
− | {{#set: produced by= | + | {{#set: smiles=CCCCCCCCCCCCCCCC(C(COP([O-])(=O)[O-])[N+])O}} |
− | + | {{#set: common name=sphinganine 1-phosphate}} | |
+ | {{#set: inchi key=InChIKey=YHEDRJPUIRMZMP-ZWKOTPCHSA-M}} | ||
+ | {{#set: molecular weight=380.484 }} | ||
+ | {{#set: common name=dihydrosphingosine 1-phosphate|DHS-1-P}} | ||
+ | {{#set: consumed by=SPHINGANINE-1-PHOSPHATE-ALDOLASE-RXN|SGPL11}} | ||
+ | {{#set: produced by=SPHINGANINE-KINASE-RXN}} |
Revision as of 16:20, 21 March 2018
Contents
Metabolite CPD-649
- smiles:
- CCCCCCCCCCCCCCCC(C(COP([O-])(=O)[O-])[N+])O
- common name:
- sphinganine 1-phosphate
- inchi key:
- InChIKey=YHEDRJPUIRMZMP-ZWKOTPCHSA-M
- molecular weight:
- 380.484
- Synonym(s):
- dihydrosphingosine 1-phosphate
- DHS-1-P
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCCCCCCCCCCCC(C(COP([O-])(=O)[O-])[N+])O" cannot be used as a page name in this wiki.