Difference between revisions of "3-HYDROXYPIMELYL-COA"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3188 CPD-3188] == * smiles: ** C1(=O)(CC[CH](N(CO)1)C2(C=NC=CC=2)) * inchi key: ** InChIKey...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-4083 RXN0-4083] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3188 CPD-3188] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-4083 RXN0-4083] ==
−
* smiles:
+
* direction:
−
** C1(=O)(CC[CH](N(CO)1)C2(C=NC=CC=2))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=GQUFOBHEPVFQMD-VIFPVBQESA-N
+
−
* common name:
+
−
** N'-hydroxymethyl-norcotinine
+
−
* molecular weight:
+
−
** 192.217   
+
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN66-169]]
+
** 1 [[NA+]][e] '''+''' 1 [[SER]][e] '''=>''' 1 [[NA+]][c] '''+''' 1 [[SER]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 Na+[e] '''+''' 1 L-serine[e] '''=>''' 1 Na+[c] '''+''' 1 L-serine[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_1764]]
 +
** Source: [[orthology-creinhardtii]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201488 25201488]
+
{{#set: gene associated=Tiso_gene_1764}}
−
* HMDB : HMDB01324
+
{{#set: in pathway=}}
−
{{#set: smiles=C1(=O)(CC[CH](N(CO)1)C2(C=NC=CC=2))}}
+
{{#set: reconstruction category=orthology}}
−
{{#set: inchi key=InChIKey=GQUFOBHEPVFQMD-VIFPVBQESA-N}}
+
{{#set: reconstruction source=orthology-creinhardtii}}
−
{{#set: common name=N'-hydroxymethyl-norcotinine}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: molecular weight=192.217    }}
+
−
{{#set: produced by=RXN66-169}}
+

Revision as of 16:00, 21 March 2018

Reaction RXN0-4083

  • direction:
    • LEFT-TO-RIGHT
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 Na+[e] + 1 L-serine[e] => 1 Na+[c] + 1 L-serine[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=3-HYDROXYPIMELYL-COA&oldid=31770"