Difference between revisions of "3-HYDROXYPIMELYL-COA"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-4083 RXN0-4083] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HYDROXYPIMELYL-COA 3-HYDROXYPIMELYL-COA] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CC(CCCC...")
 
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-4083 RXN0-4083] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-HYDROXYPIMELYL-COA 3-HYDROXYPIMELYL-COA] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CC(CCCC([O-])=O)O)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
 +
* common name:
 +
** 3-hydroxypimeloyl-CoA
 +
* inchi key:
 +
** InChIKey=VGEBXBQECGWCRH-JXUSAFQPSA-I
 +
* molecular weight:
 +
** 920.648   
 
* Synonym(s):
 
* Synonym(s):
 +
** 3-hydroxypimelyl-CoA
 +
** 5-hydroxy-7-oxoheptanoyl-CoA
 +
** 3-hydroxy-6-carboxyhexanoyl-CoA
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
== Reaction(s) known to produce the compound ==
** 1 [[NA+]][e] '''+''' 1 [[SER]][e] '''=>''' 1 [[NA+]][c] '''+''' 1 [[SER]][c]
+
== Reaction(s) of unknown directionality ==
* With common name(s):
+
* [[RXN-15013]]
** 1 Na+[e] '''+''' 1 L-serine[e] '''=>''' 1 Na+[c] '''+''' 1 L-serine[c]
+
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* Gene: [[Tiso_gene_1764]]
+
** Source: [[orthology-creinhardtii]]
+
** Source: [[orthology-creinhardtii]]
+
== Pathways  ==
+
== Reconstruction information  ==
+
* Category: [[orthology]]
+
** Source: [[orthology-creinhardtii]]
+
*** Tool: [[pantograph]]
+
 
== External links  ==
 
== External links  ==
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
{{#set: gene associated=Tiso_gene_1764}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266574 45266574]
{{#set: in pathway=}}
+
* HMDB : HMDB12155
{{#set: reconstruction category=orthology}}
+
* CHEBI:
{{#set: reconstruction source=orthology-creinhardtii}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57343 57343]
{{#set: reconstruction tool=pantograph}}
+
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C06714 C06714]
 +
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CC(CCCC([O-])=O)O)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
 +
{{#set: common name=3-hydroxypimeloyl-CoA}}
 +
{{#set: inchi key=InChIKey=VGEBXBQECGWCRH-JXUSAFQPSA-I}}
 +
{{#set: molecular weight=920.648    }}
 +
{{#set: common name=3-hydroxypimelyl-CoA|5-hydroxy-7-oxoheptanoyl-CoA|3-hydroxy-6-carboxyhexanoyl-CoA}}
 +
{{#set: reversible reaction associated=RXN-15013}}

Latest revision as of 20:23, 21 March 2018

Metabolite 3-HYDROXYPIMELYL-COA

  • smiles:
    • CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CC(CCCC([O-])=O)O)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • common name:
    • 3-hydroxypimeloyl-CoA
  • inchi key:
    • InChIKey=VGEBXBQECGWCRH-JXUSAFQPSA-I
  • molecular weight:
    • 920.648
  • Synonym(s):
    • 3-hydroxypimelyl-CoA
    • 5-hydroxy-7-oxoheptanoyl-CoA
    • 3-hydroxy-6-carboxyhexanoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)(C(O)C(=O)NCCC(=O)NCCSC(CC(CCCC([O-])=O)O)=O)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.