Difference between revisions of "3-Hydroxy-Terminated-DNAs"

Latest revision as of 20:42, 21 March 2018

"a [DNA]-3'-hydroxyl" cannot be used as a page name in this wiki.

@@ Line 1: / Line 1: @@
 [[Category:Metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-2744 CPD-2744] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-Hydroxy-Terminated-DNAs 3-Hydroxy-Terminated-DNAs] ==
-* smiles:
-** C1(CC[CH]([N+](C)1)C3(C=[N+](C2(C(C(C(C(O2)C([O-])=O)O)O)O))C=CC=3))
-* inchi key:
-** InChIKey=SAWAIULJDYFLPD-SOAFEQHCSA-O
 * common name:
-** nicotine-glucuronide
+** a [DNA]-3'-hydroxyl
-* molecular weight:
-** 339.367
 * Synonym(s):
+** a 3'-hydroxy terminated DNA
 == Reaction(s) known to consume the compound ==
+* [[DNA-LIGASE-ATP-RXN]]
+* [[RXN-17919]]
 == Reaction(s) known to produce the compound ==
-* [[RXN66-83]]
 == Reaction(s) of unknown directionality ==
 == External links  ==
-* PUBCHEM:
+{{#set: common name=a [DNA]-3'-hydroxyl}}
-** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820524 91820524]
+{{#set: common name=a 3'-hydroxy terminated DNA}}
-* HMDB : HMDB01272
+{{#set: consumed by=DNA-LIGASE-ATP-RXN|RXN-17919}}
-{{#set: smiles=C1(CC[CH]([N+](C)1)C3(C=[N+](C2(C(C(C(C(O2)C([O-])=O)O)O)O))C=CC=3))}}
-{{#set: inchi key=InChIKey=SAWAIULJDYFLPD-SOAFEQHCSA-O}}
-{{#set: common name=nicotine-glucuronide}}
-{{#set: molecular weight=339.367    }}
-{{#set: produced by=RXN66-83}}