Difference between revisions of "3-Ketoglutaryl-ACP-methyl-ester"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HOMOGENTISATE HOMOGENTISATE] == * smiles: ** C1(C(=CC(=C(C=1)O)CC([O-])=O)O) * inchi key: ** In...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-Ketoglutaryl-ACP-methyl-ester 3-Ketoglutaryl-ACP-methyl-ester] == * common name: ** a 3-oxo-g...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-Ketoglutaryl-ACP-methyl-ester 3-Ketoglutaryl-ACP-methyl-ester] == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** a 3-oxo-glutaryl-[acp] methyl ester |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** a 3-ketoglutaryl-[acp] methyl ester |
+ | ** a 3-ketoglutaryl-[acyl-carrier-protein] methyl ester | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | + | * [[RXN-11476]] | |
− | + | ||
− | * [[RXN- | + | |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-11474]] |
− | + | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | + | {{#set: common name=a 3-oxo-glutaryl-[acp] methyl ester}} | |
− | + | {{#set: common name=a 3-ketoglutaryl-[acp] methyl ester|a 3-ketoglutaryl-[acyl-carrier-protein] methyl ester}} | |
− | + | {{#set: consumed by=RXN-11476}} | |
− | + | {{#set: produced by=RXN-11474}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | + | ||
− | + | ||
− | {{#set: consumed by= | + | |
− | {{#set: produced by= | + |
Latest revision as of 21:14, 21 March 2018
Contents
Metabolite 3-Ketoglutaryl-ACP-methyl-ester
- common name:
- a 3-oxo-glutaryl-[acp] methyl ester
- Synonym(s):
- a 3-ketoglutaryl-[acp] methyl ester
- a 3-ketoglutaryl-[acyl-carrier-protein] methyl ester
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"a 3-oxo-glutaryl-[acp] methyl ester" cannot be used as a page name in this wiki.
- "a 3-ketoglutaryl-[acp] methyl ester" cannot be used as a page name in this wiki.
- "a 3-ketoglutaryl-[acyl-carrier-protein] methyl ester" cannot be used as a page name in this wiki.