Difference between revisions of "3-OXOADIPATE-ENOL-LACTONE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17373 CPD-17373] == * smiles: ** C(O)CCCCCCCC=CCCCCCCCC(OCC(OC(=O)CCCCCCCC=CCC=CCCCCCO)COP(...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-OXOADIPATE-ENOL-LACTONE 3-OXOADIPATE-ENOL-LACTONE] == * smiles: ** C(=O)(CC1(=CCC(=O)O1))[O-]...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-OXOADIPATE-ENOL-LACTONE 3-OXOADIPATE-ENOL-LACTONE] == |
* smiles: | * smiles: | ||
− | ** C(O) | + | ** C(=O)(CC1(=CCC(=O)O1))[O-] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** (4,5-dihydro-5-oxofuran-2-yl)-acetate |
+ | * inchi key: | ||
+ | ** InChIKey=ZPEHSARSWGDCEX-UHFFFAOYSA-M | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 141.103 |
* Synonym(s): | * Synonym(s): | ||
+ | ** 3-oxoadipate enol lactone | ||
+ | ** β-ketoadipate-enol-lactone | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[3-OXOADIPATE-ENOL-LACTONASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=23615198 23615198] |
− | {{#set: smiles=C(O) | + | * CHEMSPIDER: |
− | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.19951100.html 19951100] |
− | {{#set: | + | * CHEBI: |
− | {{#set: molecular weight= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58425 58425] |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C03586 C03586] |
+ | {{#set: smiles=C(=O)(CC1(=CCC(=O)O1))[O-]}} | ||
+ | {{#set: common name=(4,5-dihydro-5-oxofuran-2-yl)-acetate}} | ||
+ | {{#set: inchi key=InChIKey=ZPEHSARSWGDCEX-UHFFFAOYSA-M}} | ||
+ | {{#set: molecular weight=141.103 }} | ||
+ | {{#set: common name=3-oxoadipate enol lactone|β-ketoadipate-enol-lactone}} | ||
+ | {{#set: consumed by=3-OXOADIPATE-ENOL-LACTONASE-RXN}} |
Latest revision as of 21:19, 21 March 2018
Contents
Metabolite 3-OXOADIPATE-ENOL-LACTONE
- smiles:
- C(=O)(CC1(=CCC(=O)O1))[O-]
- common name:
- (4,5-dihydro-5-oxofuran-2-yl)-acetate
- inchi key:
- InChIKey=ZPEHSARSWGDCEX-UHFFFAOYSA-M
- molecular weight:
- 141.103
- Synonym(s):
- 3-oxoadipate enol lactone
- β-ketoadipate-enol-lactone
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(=O)(CC1(=CCC(=O)O1))[O-" cannot be used as a page name in this wiki.