Difference between revisions of "3-oxo-hexanoyl-ACPs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11715 CPD-11715] == * smiles: ** C(=O)(NCC(=O)[O-])CC1(C=CC=CC=1) * inchi key: ** InChIKey=...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACCOAtx ACCOAtx] == * direction: ** REVERSIBLE * common name: ** Acetyl-CoA:CoA antiporter, glyoxys...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11715 CPD-11715] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACCOAtx ACCOAtx] ==
−
* smiles:
+
* direction:
−
** C(=O)(NCC(=O)[O-])CC1(C=CC=CC=1)
+
** REVERSIBLE
−
* inchi key:
+
−
** InChIKey=UTYVDVLMYQPLQB-UHFFFAOYSA-M
+
 
* common name:
 
* common name:
−
** phenylacetylglycine
+
** Acetyl-CoA:CoA antiporter, glyoxysomal
−
* molecular weight:
+
−
** 192.194   
+
 
* Synonym(s):
 
* Synonym(s):
−
** phenaceturic acid
 
−
** phenacetylglycine
 
−
** N-phenacetylglycine
 
−
** N-phenylacetylglycine
 
−
** N-(phenylacetyl)glycine
 
−
** glycine, N-(phenylacetyl)-
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-10821]]
+
** 1.0 [[ACETYL-COA]][c] '''+''' 1.0 [[CO-A]][x] '''<=>''' 1.0 [[ACETYL-COA]][x] '''+''' 1.0 [[CO-A]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1.0 acetyl-CoA[c] '''+''' 1.0 coenzyme A[x] '''<=>''' 1.0 acetyl-CoA[x] '''+''' 1.0 coenzyme A[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_9173]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=REVERSIBLE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=4229702 4229702]
+
{{#set: common name=Acetyl-CoA:CoA antiporter, glyoxysomal}}
−
* CHEMSPIDER:
+
{{#set: gene associated=Tiso_gene_9173}}
−
** [http://www.chemspider.com/Chemical-Structure.3438658.html 3438658]
+
{{#set: in pathway=}}
−
* CHEBI:
+
{{#set: reconstruction category=orthology}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60874 60874]
+
{{#set: reconstruction source=orthology-creinhardtii}}
−
{{#set: smiles=C(=O)(NCC(=O)[O-])CC1(C=CC=CC=1)}}
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: inchi key=InChIKey=UTYVDVLMYQPLQB-UHFFFAOYSA-M}}
+
−
{{#set: common name=phenylacetylglycine}}
+
−
{{#set: molecular weight=192.194    }}
+
−
{{#set: common name=phenaceturic acid|phenacetylglycine|N-phenacetylglycine|N-phenylacetylglycine|N-(phenylacetyl)glycine|glycine, N-(phenylacetyl)-}}
+
−
{{#set: produced by=RXN-10821}}
+

Revision as of 16:53, 21 March 2018

Reaction ACCOAtx

  • direction:
    • REVERSIBLE
  • common name:
    • Acetyl-CoA:CoA antiporter, glyoxysomal
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 acetyl-CoA[c] + 1.0 coenzyme A[x] <=> 1.0 acetyl-CoA[x] + 1.0 coenzyme A[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=3-oxo-hexanoyl-ACPs&oldid=37104"