Difference between revisions of "3.1.22.4-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19158 CPD-19158] == * smiles: ** CCCCCCC=CCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Non-Glucur-Glucuronoside-Acceptors Non-Glucur-Glucuronoside-Acceptors] == * common name: ** a n...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19158 CPD-19158] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Non-Glucur-Glucuronoside-Acceptors Non-Glucur-Glucuronoside-Acceptors] ==
* smiles:
+
** CCCCCCC=CCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
* inchi key:
+
** InChIKey=JDNARGYWMLYADA-MDMKAECGSA-J
+
 
* common name:
 
* common name:
** 3-oxo-(9Z)-hexadecenoyl-CoA
+
** a non-glucuronated glucosyluronate acceptor
* molecular weight:
+
** 1013.883   
+
 
* Synonym(s):
 
* Synonym(s):
** 3-oxo-16:1-Δ9-CoA
 
** 3-oxo-9-cis-hexadecenoyl-CoA
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17791]]
+
* [[UDP-GLUCURONOSYLTRANSFERASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17790]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
{{#set: smiles=CCCCCCC=CCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: common name=a non-glucuronated glucosyluronate acceptor}}
{{#set: inchi key=InChIKey=JDNARGYWMLYADA-MDMKAECGSA-J}}
+
{{#set: consumed by=UDP-GLUCURONOSYLTRANSFERASE-RXN}}
{{#set: common name=3-oxo-(9Z)-hexadecenoyl-CoA}}
+
{{#set: molecular weight=1013.883    }}
+
{{#set: common name=3-oxo-16:1-Δ9-CoA|3-oxo-9-cis-hexadecenoyl-CoA}}
+
{{#set: consumed by=RXN-17791}}
+
{{#set: produced by=RXN-17790}}
+

Revision as of 17:44, 10 January 2018

Metabolite Non-Glucur-Glucuronoside-Acceptors

  • common name:
    • a non-glucuronated glucosyluronate acceptor
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links