Difference between revisions of "3.1.22.4-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19158 CPD-19158] == * smiles: ** CCCCCCC=CCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.1.22.4-RXN 3.1.22.4-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** structure-specific_en...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19158 CPD-19158] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.1.22.4-RXN 3.1.22.4-RXN] ==
−
* smiles:
+
* direction:
−
** CCCCCCC=CCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=JDNARGYWMLYADA-MDMKAECGSA-J
+
 
* common name:
 
* common name:
−
** 3-oxo-(9Z)-hexadecenoyl-CoA
+
** structure-specific_endonuclease_subunit_slx1_homolog
−
* molecular weight:
+
* ec number:
−
** 1013.883   
+
** [http://enzyme.expasy.org/EC/3.1.22.4 EC-3.1.22.4]
 
* Synonym(s):
 
* Synonym(s):
−
** 3-oxo-16:1-Δ9-CoA
 
−
** 3-oxo-9-cis-hexadecenoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-17791]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[WATER]][c] '''+''' 1 [[DNA-Combined-With-Exogenous-DNA]][c] '''=>''' 1 [[Resolution-of-Recombinational-Junction]][c]
−
* [[RXN-17790]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 H2O[c] '''+''' 1 DNA combined with exogenous DNA to form a recombinational junction[c] '''=>''' 1 resolution of recombinational junction formation of two intact strands[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_11797]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
{{#set: smiles=CCCCCCC=CCCCCCC(=O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
* UNIPROT:
−
{{#set: inchi key=InChIKey=JDNARGYWMLYADA-MDMKAECGSA-J}}
+
** [http://www.uniprot.org/uniprot/P0A814 P0A814]
−
{{#set: common name=3-oxo-(9Z)-hexadecenoyl-CoA}}
+
** [http://www.uniprot.org/uniprot/P44633 P44633]
−
{{#set: molecular weight=1013.883    }}
+
** [http://www.uniprot.org/uniprot/O83530 O83530]
−
{{#set: common name=3-oxo-16:1-Δ9-CoA|3-oxo-9-cis-hexadecenoyl-CoA}}
+
** [http://www.uniprot.org/uniprot/O84510 O84510]
−
{{#set: consumed by=RXN-17791}}
+
** [http://www.uniprot.org/uniprot/O25544 O25544]
−
{{#set: produced by=RXN-17790}}
+
** [http://www.uniprot.org/uniprot/Q9PLU8 Q9PLU8]
 +
** [http://www.uniprot.org/uniprot/Q51424 Q51424]
 +
** [http://www.uniprot.org/uniprot/Q37873 Q37873]
 +
** [http://www.uniprot.org/uniprot/P0AG74 P0AG74]
 +
** [http://www.uniprot.org/uniprot/Q55506 Q55506]
 +
{{#set: direction=LEFT-TO-RIGHT}}
 +
{{#set: common name=structure-specific_endonuclease_subunit_slx1_homolog}}
 +
{{#set: ec number=EC-3.1.22.4}}
 +
{{#set: gene associated=Tiso_gene_11797}}
 +
{{#set: in pathway=}}
 +
{{#set: reconstruction category=annotation}}
 +
{{#set: reconstruction source=annotation-in-silico_annotation}}
 +
{{#set: reconstruction tool=pathwaytools}}

Latest revision as of 20:51, 21 March 2018

Reaction 3.1.22.4-RXN

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • structure-specific_endonuclease_subunit_slx1_homolog
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links





Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=3.1.22.4-RXN&oldid=44182"