Difference between revisions of "3.1.3.74-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THYMINE THYMINE] == * smiles: ** CC1(C(=O)NC(NC=1)=O) * inchi key: ** InChIKey=RWQNBRDOKXIBIV-U...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9552 RXN-9552] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-oxo-petroslinoyl-[acyl-carr...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THYMINE THYMINE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9552 RXN-9552] ==
−
* smiles:
+
* direction:
−
** CC1(C(=O)NC(NC=1)=O)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=RWQNBRDOKXIBIV-UHFFFAOYSA-N
+
 
* common name:
 
* common name:
−
** thymine
+
** 3-oxo-petroslinoyl-[acyl-carrier protein] reductase
−
* molecular weight:
+
** 3-oxoacyl-(acyl-carrier-protein)
−
** 126.115   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/1.1.1.100 EC-1.1.1.100]
 
* Synonym(s):
 
* Synonym(s):
−
** 5-methyluracil
 
−
** 5-methyl-2,4(1H,3H)-pyrimidinedione
 
−
** T
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
== Reaction(s) of unknown directionality ==
+
** 1 [[3-oxo-petroselinoyl-ACPs]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[NADPH]][c] '''=>''' 1 [[NADP]][c] '''+''' 1 [[R-3-hydroxypetroselinoyl-ACPs]][c]
−
* [[THYM-PHOSPH-RXN]]
+
* With common name(s):
 +
** 1 a 3-oxo-petroselinoyl-[acp][c] '''+''' 1 H+[c] '''+''' 1 NADPH[c] '''=>''' 1 NADP+[c] '''+''' 1 a (3R)-3-hydroxypetroselinoyl-[acp][c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_9885]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_13083]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY-5367]], petroselinate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5367 PWY-5367]
 +
** '''3''' reactions found over '''6''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CAS : 65-71-4
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* METABOLIGHTS : MTBLC17821
+
{{#set: common name=3-oxo-petroslinoyl-[acyl-carrier protein] reductase}}
−
* DRUGBANK : DB03462
+
{{#set: common name=3-oxoacyl-(acyl-carrier-protein)}}
−
* PUBCHEM:
+
{{#set: ec number=EC-1.1.1.100}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=1135 1135]
+
{{#set: gene associated=Tiso_gene_9885|Tiso_gene_13083}}
−
* HMDB : HMDB00262
+
{{#set: in pathway=PWY-5367}}
−
* LIGAND-CPD:
+
{{#set: reconstruction category=orthology|annotation}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00178 C00178]
+
{{#set: reconstruction source=annotation-experimental_annotation|annotation-in-silico_annotation|orthology-esiliculosus}}
−
* CHEMSPIDER:
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
−
** [http://www.chemspider.com/Chemical-Structure.1103.html 1103]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17821 17821]
+
−
* BIGG : thym
+
−
{{#set: smiles=CC1(C(=O)NC(NC=1)=O)}}
+
−
{{#set: inchi key=InChIKey=RWQNBRDOKXIBIV-UHFFFAOYSA-N}}
+
−
{{#set: common name=thymine}}
+
−
{{#set: molecular weight=126.115    }}
+
−
{{#set: common name=5-methyluracil|5-methyl-2,4(1H,3H)-pyrimidinedione|T}}
+
−
{{#set: reversible reaction associated=THYM-PHOSPH-RXN}}
+

Revision as of 16:48, 21 March 2018

Reaction RXN-9552

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 3-oxo-petroslinoyl-[acyl-carrier protein] reductase
    • 3-oxoacyl-(acyl-carrier-protein)
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5367, petroselinate biosynthesis: PWY-5367
    • 3 reactions found over 6 reactions in the full pathway

Reconstruction information

External links

"3-oxo-petroslinoyl-[acyl-carrier protein] reductase" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=3.1.3.74-RXN&oldid=36426"