Difference between revisions of "325-BISPHOSPHATE-NUCLEOTIDASE-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_4164 == * left end position: ** 6 * transcription direction: ** NEGATIVE * right end position: ** 7436 * centisome position: ** 3.927215600...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NICOTINE NICOTINE] == * smiles: ** C1(CC[CH]([N+](C)1)C2(C=NC=CC=2)) * inchi key: ** InChIKey=S...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_4164 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=NICOTINE NICOTINE] ==
−
* left end position:
+
* smiles:
−
** 6
+
** C1(CC[CH]([N+](C)1)C2(C=NC=CC=2))
−
* transcription direction:
+
* inchi key:
−
** NEGATIVE
+
** InChIKey=SNICXCGAKADSCV-JTQLQIEISA-O
−
* right end position:
+
* common name:
−
** 7436
+
** (S)-nicotine
−
* centisome position:
+
* molecular weight:
−
** 3.927215600e-2
+
** 163.242   
 
* Synonym(s):
 
* Synonym(s):
 +
** nicotine
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[3.1.3.16-RXN]]
+
* [[RXN66-81]]
−
** in-silico_annotation
+
* [[RXN66-146]]
−
***automated-name-match
+
* [[RXN66-83]]
−
* [[PROTEIN-TYROSINE-PHOSPHATASE-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** in-silico_annotation
+
== Reaction(s) of unknown directionality ==
−
***automated-name-match
+
−
== Pathways associated ==
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=6}}
+
* NCI:
−
{{#set: transcription direction=NEGATIVE}}
+
** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=5065 5065]
−
{{#set: right end position=7436}}
+
* PUBCHEM:
−
{{#set: centisome position=3.927215600e-2}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6919000 6919000]
−
{{#set: reaction associated=3.1.3.16-RXN|PROTEIN-TYROSINE-PHOSPHATASE-RXN}}
+
* HMDB : HMDB01934
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C00745 C00745]
 +
* CHEMSPIDER:
 +
** [http://www.chemspider.com/Chemical-Structure.5294163.html 5294163]
 +
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=59806 59806]
 +
{{#set: smiles=C1(CC[CH]([N+](C)1)C2(C=NC=CC=2))}}
 +
{{#set: inchi key=InChIKey=SNICXCGAKADSCV-JTQLQIEISA-O}}
 +
{{#set: common name=(S)-nicotine}}
 +
{{#set: molecular weight=163.242    }}
 +
{{#set: common name=nicotine}}
 +
{{#set: consumed by=RXN66-81|RXN66-146|RXN66-83}}

Revision as of 19:43, 18 March 2018

Metabolite NICOTINE

  • smiles:
    • C1(CC[CH]([N+](C)1)C2(C=NC=CC=2))
  • inchi key:
    • InChIKey=SNICXCGAKADSCV-JTQLQIEISA-O
  • common name:
    • (S)-nicotine
  • molecular weight:
    • 163.242
  • Synonym(s):
    • nicotine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C1(CC[CH]([N+](C)1)C2(C=NC=CC=2))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=325-BISPHOSPHATE-NUCLEOTIDASE-RXN&oldid=26355"