Difference between revisions of "4-ALPHA-METHYL-5-ALPHA-CHOLEST-7-EN-3-ON"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-2023 RXN0-2023] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-ALPHA-METHYL-5-ALPHA-CHOLEST-7-EN-3-ON 4-ALPHA-METHYL-5-ALPHA-CHOLEST-7-EN-3-ON] == * smiles:...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-2023 RXN0-2023] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-ALPHA-METHYL-5-ALPHA-CHOLEST-7-EN-3-ON 4-ALPHA-METHYL-5-ALPHA-CHOLEST-7-EN-3-ON] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(C)CCC[CH](C)[CH]3(CC[CH]4(C2(=CC[CH]1(C(C)C(=O)CCC(C)1[CH]2CCC(C)34))))
−
* ec number:
+
* common name:
−
** [http://enzyme.expasy.org/EC/2.8.1.13 EC-2.8.1.13]
+
** 4α-methyl-5α-cholest-7-en-3-one
 +
* inchi key:
 +
** InChIKey=OWKGVPXWOHLTSL-LIUJFMQASA-N
 +
* molecular weight:
 +
** 398.671   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[TusE-S-sulfanylcysteine]][c] '''+''' 1 [[Donor-H2]][c] '''+''' 1 [[tRNA-uridine34]][c] '''+''' 1 [[ATP]][c] '''=>''' 1 [[PPI]][c] '''+''' 1 [[AMP]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[Acceptor]][c] '''+''' 1 [[TusE-L-cysteine]][c] '''+''' 1 [[tRNA-2-thiouridine34]][c]
+
== Reaction(s) of unknown directionality ==
−
* With common name(s):
+
* [[1.1.1.170-RXN]]
−
** 1 a [TusE sulfur carrier protein]-S-sulfanylcysteine[c] '''+''' 1 a reduced electron acceptor[c] '''+''' 1 a uridine34 in tRNA[c] '''+''' 1 ATP[c] '''=>''' 1 diphosphate[c] '''+''' 1 AMP[c] '''+''' 1 H+[c] '''+''' 1 an oxidized electron acceptor[c] '''+''' 1 a [TusE sulfur carrier protein]-L-cysteine[c] '''+''' 1 a 2-thiouridine34 in tRNA[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_2786]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[esiliculosus]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: ec number=EC-2.8.1.13}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=440345 440345]
−
{{#set: gene associated=Tiso_gene_2786}}
+
* CHEMSPIDER:
−
{{#set: in pathway=}}
+
** [http://www.chemspider.com/Chemical-Structure.389311.html 389311]
−
{{#set: reconstruction category=orthology}}
+
* HMDB : HMDB11606
−
{{#set: reconstruction tool=pantograph}}
+
* CHEBI:
−
{{#set: reconstruction source=esiliculosus}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16495 16495]
 +
* LIGAND-CPD:
 +
** [http://www.genome.jp/dbget-bin/www_bget?C04453 C04453]
 +
{{#set: smiles=CC(C)CCC[CH](C)[CH]3(CC[CH]4(C2(=CC[CH]1(C(C)C(=O)CCC(C)1[CH]2CCC(C)34))))}}
 +
{{#set: common name=4α-methyl-5α-cholest-7-en-3-one}}
 +
{{#set: inchi key=InChIKey=OWKGVPXWOHLTSL-LIUJFMQASA-N}}
 +
{{#set: molecular weight=398.671    }}
 +
{{#set: reversible reaction associated=1.1.1.170-RXN}}

Latest revision as of 20:33, 21 March 2018

Metabolite 4-ALPHA-METHYL-5-ALPHA-CHOLEST-7-EN-3-ON

  • smiles:
    • CC(C)CCC[CH](C)[CH]3(CC[CH]4(C2(=CC[CH]1(C(C)C(=O)CCC(C)1[CH]2CCC(C)34))))
  • common name:
    • 4α-methyl-5α-cholest-7-en-3-one
  • inchi key:
    • InChIKey=OWKGVPXWOHLTSL-LIUJFMQASA-N
  • molecular weight:
    • 398.671
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)CCC[CH](C)[CH]3(CC[CH]4(C2(=CC[CH]1(C(C)C(=O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=4-ALPHA-METHYL-5-ALPHA-CHOLEST-7-EN-3-ON&oldid=42342"