Difference between revisions of "A-GALACTOSYLCERAMIDE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10994 RXN-10994] == * direction: ** REVERSIBLE * common name: ** 4_-phosphopantetheinyl_transfe...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-ALPHA-HYDROXYETHYL-THPP 2-ALPHA-HYDROXYETHYL-THPP] == * smiles: ** CC2(=C(SC(C(C)O)=[N+](CC1(...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10994 RXN-10994] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-ALPHA-HYDROXYETHYL-THPP 2-ALPHA-HYDROXYETHYL-THPP] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** CC2(=C(SC(C(C)O)=[N+](CC1(C=NC(C)=NC(N)=1))2)CCOP(=O)([O-])OP(=O)([O-])[O-])
 
* common name:
 
* common name:
−
** 4_-phosphopantetheinyl_transferase
+
** 2-(α-hydroxyethyl)thiamine diphosphate
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/2.7.8.7 EC-2.7.8.7]
+
** InChIKey=RRUVJGASJONMDY-UHFFFAOYSA-L
 +
* molecular weight:
 +
** 466.341   
 
* Synonym(s):
 
* Synonym(s):
 +
** 2-(α-hydroxyethyl)-TPP
 +
** 2-(α-hydroxyethyl)-ThPP
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-12508]]
−
** 1 [[VibB]][c] '''+''' 1 [[CO-A]][c] '''<=>''' 1 [[3-5-ADP]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[holo-VibB]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
* [[RXN-12583]]
−
** 1 an apo-[VibB aryl-carrier protein][c] '''+''' 1 coenzyme A[c] '''<=>''' 1 adenosine 3',5'-bisphosphate[c] '''+''' 1 H+[c] '''+''' 1 a holo-[VibB aryl-carrier protein][c]
+
== Reaction(s) of unknown directionality ==
−
 
+
* [[RXN-14037]]
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_14278]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=REVERSIBLE}}
+
* PUBCHEM:
−
{{#set: common name=4_-phosphopantetheinyl_transferase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878487 46878487]
−
{{#set: ec number=EC-2.7.8.7}}
+
* CHEBI:
−
{{#set: gene associated=Tiso_gene_14278}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58939 58939]
−
{{#set: in pathway=}}
+
{{#set: smiles=CC2(=C(SC(C(C)O)=[N+](CC1(C=NC(C)=NC(N)=1))2)CCOP(=O)([O-])OP(=O)([O-])[O-])}}
−
{{#set: reconstruction category=annotation}}
+
{{#set: common name=2-(&alpha;-hydroxyethyl)thiamine diphosphate}}
−
{{#set: reconstruction source=annotation-in-silico_annotation}}
+
{{#set: inchi key=InChIKey=RRUVJGASJONMDY-UHFFFAOYSA-L}}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: molecular weight=466.341    }}
 +
{{#set: common name=2-(&alpha;-hydroxyethyl)-TPP|2-(&alpha;-hydroxyethyl)-ThPP}}
 +
{{#set: consumed by=RXN-12508}}
 +
{{#set: produced by=RXN-12583}}
 +
{{#set: reversible reaction associated=RXN-14037}}

Revision as of 16:49, 21 March 2018

Metabolite 2-ALPHA-HYDROXYETHYL-THPP

  • smiles:
    • CC2(=C(SC(C(C)O)=[N+](CC1(C=NC(C)=NC(N)=1))2)CCOP(=O)([O-])OP(=O)([O-])[O-])
  • common name:
    • 2-(α-hydroxyethyl)thiamine diphosphate
  • inchi key:
    • InChIKey=RRUVJGASJONMDY-UHFFFAOYSA-L
  • molecular weight:
    • 466.341
  • Synonym(s):
    • 2-(α-hydroxyethyl)-TPP
    • 2-(α-hydroxyethyl)-ThPP

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC2(=C(SC(C(C)O)=[N+](CC1(C=NC(C)=NC(N)=1))2)CCOP(=O)([O-])OP(=O)([O-])[O-])" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=A-GALACTOSYLCERAMIDE&oldid=36476"