Difference between revisions of "ACACT4"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6994 CPD-6994] == * smiles: ** C3(C(C2(OC1(C=C(C=C(C=1C(C2)=O)O)[O-])))=CC(=C(C=3)O)O) * in...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACACT4 ACACT4] == * direction: ** REVERSIBLE * common name: ** Octanoyl-CoA:acetyl-CoA C-acyltransf...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6994 CPD-6994] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACACT4 ACACT4] ==
* smiles:
+
* direction:
** C3(C(C2(OC1(C=C(C=C(C=1C(C2)=O)O)[O-])))=CC(=C(C=3)O)O)
+
** REVERSIBLE
* inchi key:
+
** InChIKey=SBHXYTNGIZCORC-ZDUSSCGKSA-M
+
 
* common name:
 
* common name:
** (2S)-eriodictyol
+
** Octanoyl-CoA:acetyl-CoA C-acyltransferase
* molecular weight:
+
** 287.248   
+
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-7775]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1.0 [[CPD0-2123]][x] '''+''' 1.0 [[CO-A]][x] '''<=>''' 1.0 [[ACETYL-COA]][x] '''+''' 1.0 [[CPD-196]][x]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1.0 3-oxodecanoyl-CoA[x] '''+''' 1.0 coenzyme A[x] '''<=>''' 1.0 acetyl-CoA[x] '''+''' 1.0 octanoyl-CoA[x]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_16181]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=REVERSIBLE}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657147 90657147]
+
{{#set: common name=Octanoyl-CoA:acetyl-CoA C-acyltransferase}}
* CHEBI:
+
{{#set: gene associated=Tiso_gene_16181}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28412 28412]
+
{{#set: in pathway=}}
* LIGAND-CPD:
+
{{#set: reconstruction category=orthology}}
** [http://www.genome.jp/dbget-bin/www_bget?C05631 C05631]
+
{{#set: reconstruction source=orthology-creinhardtii}}
* HMDB : HMDB05810
+
{{#set: reconstruction tool=pantograph}}
{{#set: smiles=C3(C(C2(OC1(C=C(C=C(C=1C(C2)=O)O)[O-])))=CC(=C(C=3)O)O)}}
+
{{#set: inchi key=InChIKey=SBHXYTNGIZCORC-ZDUSSCGKSA-M}}
+
{{#set: common name=(2S)-eriodictyol}}
+
{{#set: molecular weight=287.248    }}
+
{{#set: consumed by=RXN-7775}}
+

Latest revision as of 21:19, 21 March 2018

Reaction ACACT4

  • direction:
    • REVERSIBLE
  • common name:
    • Octanoyl-CoA:acetyl-CoA C-acyltransferase
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 3-oxodecanoyl-CoA[x] + 1.0 coenzyme A[x] <=> 1.0 acetyl-CoA[x] + 1.0 octanoyl-CoA[x]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links