Difference between revisions of "ACP-S-ACETYLTRANSFER-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CROTONYL-COA CROTONYL-COA] == * smiles: ** CC=CC(SCCNC(CCNC(C(C(COP(=O)([O-])OP(OCC1(OC(C(C1OP(...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACP-S-ACETYLTRANSFER-RXN ACP-S-ACETYLTRANSFER-RXN] == * direction: ** REVERSIBLE * common name: **...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CROTONYL-COA CROTONYL-COA] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACP-S-ACETYLTRANSFER-RXN ACP-S-ACETYLTRANSFER-RXN] ==
−
* smiles:
+
* direction:
−
** CC=CC(SCCNC(CCNC(C(C(COP(=O)([O-])OP(OCC1(OC(C(C1OP([O-])([O-])=O)O)N3(C=NC2(C(=NC=NC=23)N))))([O-])=O)(C)C)O)=O)=O)=O
+
** REVERSIBLE
−
* inchi key:
+
−
** InChIKey=KFWWCMJSYSSPSK-BOGFJHSMSA-J
+
 
* common name:
 
* common name:
−
** crotonyl-CoA
+
** polyketide_synthase
−
* molecular weight:
+
* ec number:
−
** 831.577   
+
** [http://enzyme.expasy.org/EC/2.3.1.86 EC-2.3.1.86]
 +
** [http://enzyme.expasy.org/EC/2.3.1.85 EC-2.3.1.85]
 +
** [http://enzyme.expasy.org/EC/2.3.1.38 EC-2.3.1.38]
 
* Synonym(s):
 
* Synonym(s):
−
** crotonyl-S-CoA
 
−
** crotonyl-coenzyme A
 
−
** crotonoyl-CoA
 
−
** 2-butenoyl-CoA
 
−
** trans-but-2-enoyl-CoA
 
−
** but-2-enoyl-CoA
 
−
** trans-butyr-2-enoyl-CoA
 
−
** (E)-but-2-enoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[ACOA40or]]
+
** 1 [[ACP]][c] '''+''' 1 [[ACETYL-COA]][c] '''<=>''' 1 [[CO-A]][c] '''+''' 1 [[ACETYL-ACP]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
−
* [[VINYLACETYL-COA-DELTA-ISOMERASE-RXN]]
+
** 1 a holo-[acyl-carrier protein][c] '''+''' 1 acetyl-CoA[c] '''<=>''' 1 coenzyme A[c] '''+''' 1 an acetyl-[acp][c]
−
* [[RXN-11667]]
+
 
−
* [[HBCHL]]
+
== Genes associated with this reaction  ==
−
* [[HBCHLm]]
+
Genes have been associated with this reaction based on different elements listed below.
−
* [[RXN-14193]]
+
* Gene: [[Tiso_gene_15991]]
−
* [[BCor]]
+
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-synechocystis]]
 +
* Gene: [[Tiso_gene_135]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_136]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_13394]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_500]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_10876]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-5966]], fatty acid biosynthesis initiation II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5966 PWY-5966]
 +
** '''2''' reactions found over '''2''' reactions in the full pathway
 +
* [[FASYN-INITIAL-PWY]], superpathway of fatty acid biosynthesis initiation (E. coli): [http://metacyc.org/META/NEW-IMAGE?object=FASYN-INITIAL-PWY FASYN-INITIAL-PWY]
 +
** '''5''' reactions found over '''8''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-athaliana]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-synechocystis]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[manual]]
 +
** Source: [[manual-primary_network]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* UM-BBD-CPD : c0032
+
* LIGAND-RXN:
−
* CAS : 102680-35-3
+
** [http://www.genome.jp/dbget-bin/www_bget?R01624 R01624]
−
* METABOLIGHTS : MTBLC57332
+
* UNIPROT:
−
* PUBCHEM:
+
** [http://www.uniprot.org/uniprot/P49327 P49327]
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245057 25245057]
+
** [http://www.uniprot.org/uniprot/P08757 P08757]
−
* HMDB : HMDB02009
+
** [http://www.uniprot.org/uniprot/P07149 P07149]
−
* LIGAND-CPD:
+
** [http://www.uniprot.org/uniprot/P12276 P12276]
−
** [http://www.genome.jp/dbget-bin/www_bget?C00877 C00877]
+
** [http://www.uniprot.org/uniprot/P12785 P12785]
−
* CHEBI:
+
{{#set: direction=REVERSIBLE}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57332 57332]
+
{{#set: common name=polyketide_synthase}}
−
* BIGG : b2coa
+
{{#set: ec number=EC-2.3.1.86}}
−
{{#set: smiles=CC=CC(SCCNC(CCNC(C(C(COP(=O)([O-])OP(OCC1(OC(C(C1OP([O-])([O-])=O)O)N3(C=NC2(C(=NC=NC=23)N))))([O-])=O)(C)C)O)=O)=O)=O}}
+
{{#set: ec number=EC-2.3.1.85}}
−
{{#set: inchi key=InChIKey=KFWWCMJSYSSPSK-BOGFJHSMSA-J}}
+
{{#set: ec number=EC-2.3.1.38}}
−
{{#set: common name=crotonyl-CoA}}
+
{{#set: gene associated=Tiso_gene_15991|Tiso_gene_135|Tiso_gene_136|Tiso_gene_13394|Tiso_gene_500|Tiso_gene_10876}}
−
{{#set: molecular weight=831.577    }}
+
{{#set: in pathway=PWY-5966|FASYN-INITIAL-PWY}}
−
{{#set: common name=crotonyl-S-CoA|crotonyl-coenzyme A|crotonoyl-CoA|2-butenoyl-CoA|trans-but-2-enoyl-CoA|but-2-enoyl-CoA|trans-butyr-2-enoyl-CoA|(E)-but-2-enoyl-CoA}}
+
{{#set: reconstruction category=orthology|manual|annotation}}
−
{{#set: produced by=ACOA40or}}
+
{{#set: reconstruction source=manual-primary_network|orthology-athaliana|annotation-in-silico_annotation|orthology-synechocystis}}
−
{{#set: consumed or produced by=VINYLACETYL-COA-DELTA-ISOMERASE-RXN|RXN-11667|HBCHL|HBCHLm|RXN-14193|BCor}}
+
{{#set: reconstruction tool=pantograph|pathwaytools}}

Latest revision as of 20:40, 21 March 2018

Reaction ACP-S-ACETYLTRANSFER-RXN

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 a holo-[acyl-carrier protein][c] + 1 acetyl-CoA[c] <=> 1 coenzyme A[c] + 1 an acetyl-[acp][c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5966, fatty acid biosynthesis initiation II: PWY-5966
    • 2 reactions found over 2 reactions in the full pathway
  • FASYN-INITIAL-PWY, superpathway of fatty acid biosynthesis initiation (E. coli): FASYN-INITIAL-PWY
    • 5 reactions found over 8 reactions in the full pathway

Reconstruction information

External links






Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=ACP-S-ACETYLTRANSFER-RXN&oldid=43136"