Difference between revisions of "ADENOSINE-KINASE-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16817 CPD-16817] == * smiles: ** C2(C=CC1(=C(C(OS([O-])(=O)=O)=CN1)C=2)) * common name: **...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ADENOSINE-KINASE-RXN ADENOSINE-KINASE-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** ORF *...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16817 CPD-16817] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=ADENOSINE-KINASE-RXN ADENOSINE-KINASE-RXN] ==
* smiles:
+
* direction:
** C2(C=CC1(=C(C(OS([O-])(=O)=O)=CN1)C=2))
+
** LEFT-TO-RIGHT
 
* common name:
 
* common name:
** indoxyl sulfate
+
** ORF
* inchi key:
+
* ec number:
** InChIKey=BXFFHSIDQOFMLE-UHFFFAOYSA-M
+
** [http://enzyme.expasy.org/EC/2.7.1.20 EC-2.7.1.20]
* molecular weight:
+
** 212.2  
+
 
* Synonym(s):
 
* Synonym(s):
** indol-3-yl sulfate
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
== Reaction(s) of unknown directionality ==
+
** 1 [[ADENOSINE]][c] '''+''' 1 [[ATP]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[AMP]][c] '''+''' 1 [[ADP]][c]
* [[RXN-15587]]
+
* With common name(s):
 +
** 1 adenosine[c] '''+''' 1 ATP[c] '''=>''' 1 H+[c] '''+''' 1 AMP[c] '''+''' 1 ADP[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_12078]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-6619]], adenine and adenosine salvage VI: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6619 PWY-6619]
 +
** '''1''' reactions found over '''1''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[manual]]
 +
** Source: [[manual-primary_network]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* RHEA:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=4453098 4453098]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=20824 20824]
* CHEBI:
+
* LIGAND-RXN:
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=43355 43355]
+
** [http://www.genome.jp/dbget-bin/www_bget?R00185 R00185]
* HMDB : HMDB00682
+
* UNIPROT:
{{#set: smiles=C2(C=CC1(=C(C(OS([O-])(=O)=O)=CN1)C=2))}}
+
** [http://www.uniprot.org/uniprot/Q64640 Q64640]
{{#set: common name=indoxyl sulfate}}
+
** [http://www.uniprot.org/uniprot/P55263 P55263]
{{#set: inchi key=InChIKey=BXFFHSIDQOFMLE-UHFFFAOYSA-M}}
+
{{#set: direction=LEFT-TO-RIGHT}}
{{#set: molecular weight=212.2    }}
+
{{#set: common name=ORF}}
{{#set: common name=indol-3-yl sulfate}}
+
{{#set: ec number=EC-2.7.1.20}}
{{#set: reversible reaction associated=RXN-15587}}
+
{{#set: gene associated=Tiso_gene_12078}}
 +
{{#set: in pathway=PWY-6619}}
 +
{{#set: reconstruction category=manual|annotation}}
 +
{{#set: reconstruction source=annotation-experimental_annotation|manual-primary_network|annotation-in-silico_annotation}}
 +
{{#set: reconstruction tool=pathwaytools}}

Latest revision as of 21:12, 21 March 2018

Reaction ADENOSINE-KINASE-RXN

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • ORF
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 adenosine[c] + 1 ATP[c] => 1 H+[c] + 1 AMP[c] + 1 ADP[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6619, adenine and adenosine salvage VI: PWY-6619
    • 1 reactions found over 1 reactions in the full pathway

Reconstruction information

External links