Difference between revisions of "ASPARAGINE-DEG1-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-341 CPD0-341] == * smiles: ** C(N)(=O)CCCCC(SC(=O)CCC(=O)[O-])CCS * inchi key: ** InChIKey...") |
(Created page with "Category:Gene == Gene Tiso_gene_17030 == * left end position: ** 408 * transcription direction: ** POSITIVE * right end position: ** 1970 * centisome position: ** 10.29003...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_17030 == |
− | * | + | * left end position: |
− | ** | + | ** 408 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 1970 |
− | * | + | * centisome position: |
− | ** | + | ** 10.290038 |
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reactions associated == |
− | + | * [[RXN-15556]] | |
− | == | + | ** in-silico_annotation |
− | * [[ | + | ***ec-number |
+ | * [[UBIQUITIN--PROTEIN-LIGASE-RXN]] | ||
+ | ** in-silico_annotation | ||
+ | ***ec-number | ||
+ | == Pathways associated == | ||
+ | * [[PWY-7511]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=408}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=1970}} | |
− | + | {{#set: centisome position=10.290038 }} | |
− | + | {{#set: reaction associated=RXN-15556|UBIQUITIN--PROTEIN-LIGASE-RXN}} | |
− | + | {{#set: pathway associated=PWY-7511}} | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 17:42, 10 January 2018
Gene Tiso_gene_17030
- left end position:
- 408
- transcription direction:
- POSITIVE
- right end position:
- 1970
- centisome position:
- 10.290038
- Synonym(s):
Reactions associated
- RXN-15556
- in-silico_annotation
- ec-number
- in-silico_annotation
- UBIQUITIN--PROTEIN-LIGASE-RXN
- in-silico_annotation
- ec-number
- in-silico_annotation