Difference between revisions of "BENZENE-NO2"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11476 RXN-11476] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-oxo-glutaryl-[acp] methyl...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BENZENE-NO2 BENZENE-NO2] == * smiles: ** C1(=CC=C(C=C1)[N+]([O-])=O) * common name: ** nitroben...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BENZENE-NO2 BENZENE-NO2] == |
| − | * | + | * smiles: |
| − | ** | + | ** C1(=CC=C(C=C1)[N+]([O-])=O) |
* common name: | * common name: | ||
| − | ** | + | ** nitrobenzene |
| − | ** | + | * inchi key: |
| − | * | + | ** InChIKey=LQNUZADURLCDLV-UHFFFAOYSA-N |
| − | ** | + | * molecular weight: |
| + | ** 123.111 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** benzene-NO2 | ||
| + | ** nitro-benzene | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | + | * [[RXN-3661]] | |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | = | + | |
| − | + | ||
| − | * | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | + | * CAS : 98-95-3 | |
| − | + | * PUBCHEM: | |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7416 7416] |
| − | + | * HMDB : HMDB41950 | |
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C06813 C06813] |
| − | {{#set: | + | * CHEMSPIDER: |
| − | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.7138.html 7138] |
| − | {{#set: | + | * CHEBI: |
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27798 27798] | ||
| + | {{#set: smiles=C1(=CC=C(C=C1)[N+]([O-])=O)}} | ||
| + | {{#set: common name=nitrobenzene}} | ||
| + | {{#set: inchi key=InChIKey=LQNUZADURLCDLV-UHFFFAOYSA-N}} | ||
| + | {{#set: molecular weight=123.111 }} | ||
| + | {{#set: common name=benzene-NO2|nitro-benzene}} | ||
| + | {{#set: consumed by=RXN-3661}} | ||
Latest revision as of 21:22, 21 March 2018
Contents
Metabolite BENZENE-NO2
- smiles:
- C1(=CC=C(C=C1)[N+]([O-])=O)
- common name:
- nitrobenzene
- inchi key:
- InChIKey=LQNUZADURLCDLV-UHFFFAOYSA-N
- molecular weight:
- 123.111
- Synonym(s):
- benzene-NO2
- nitro-benzene
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(=CC=C(C=C1)[N+]([O-])=O)" cannot be used as a page name in this wiki.
