Difference between revisions of "CPD-13793"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10608 RXN-10608] == * direction: ** LEFT-TO-RIGHT * common name: ** exostosin_family_protein *...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13793 CPD-13793] == * smiles: ** CCC(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10608 RXN-10608] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13793 CPD-13793] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CCC(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CCC(C)34))))
 
* common name:
 
* common name:
−
** exostosin_family_protein
+
** 3-oxo-24-ethyl-cholest-5-ene
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/2.4.1.17 EC-2.4.1.17]
+
** InChIKey=KYOFIJXMVNQYFC-XJZKHKOHSA-N
 +
* molecular weight:
 +
** 412.698   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[L-THYROXINE]][c] '''+''' 1 [[UDP-GLUCURONATE]][c] '''=>''' 1 [[UDP]][c] '''+''' 1 [[CPD-11401]][c] '''+''' 1 [[PROTON]][c]
+
* [[RXN-12789]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 L-thyroxine[c] '''+''' 1 UDP-α-D-glucuronate[c] '''=>''' 1 UDP[c] '''+''' 1 L-thyroxine acyl β-D-glucuronide[c] '''+''' 1 H+[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_14140]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
* [[Tiso_gene_14141]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
== Pathways  ==
+
−
* [[PWY-6261]], thyroid hormone metabolism II (via conjugation and/or degradation): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6261 PWY-6261]
+
−
** '''11''' reactions found over '''15''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=exostosin_family_protein}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9801811 9801811]
−
{{#set: ec number=EC-2.4.1.17}}
+
{{#set: smiles=CCC(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CCC(C)34))))}}
−
{{#set: gene associated=Tiso_gene_14140|Tiso_gene_14141}}
+
{{#set: common name=3-oxo-24-ethyl-cholest-5-ene}}
−
{{#set: in pathway=PWY-6261}}
+
{{#set: inchi key=InChIKey=KYOFIJXMVNQYFC-XJZKHKOHSA-N}}
−
{{#set: reconstruction category=annotation}}
+
{{#set: molecular weight=412.698    }}
−
{{#set: reconstruction source=annotation-in-silico_annotation}}
+
{{#set: produced by=RXN-12789}}
−
{{#set: reconstruction tool=pathwaytools}}
+

Latest revision as of 21:24, 21 March 2018

Metabolite CPD-13793

  • smiles:
    • CCC(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CCC(C)34))))
  • common name:
    • 3-oxo-24-ethyl-cholest-5-ene
  • inchi key:
    • InChIKey=KYOFIJXMVNQYFC-XJZKHKOHSA-N
  • molecular weight:
    • 412.698
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCC(C(C)C)CCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-13793&oldid=48467"