Difference between revisions of "CPD-19147"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-6948 RXN0-6948] == * direction: ** LEFT-TO-RIGHT * common name: ** n-acetylglutamate_synthase...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19147 CPD-19147] == * smiles: ** CCCCCCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19147 CPD-19147] == |
| − | * | + | * smiles: |
| − | ** | + | ** CCCCCCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
* common name: | * common name: | ||
| − | ** | + | ** (7Z)-tetradecenoyl-CoA |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=JPIHVKICKVPFFY-TWAFKMGKSA-J |
| + | * molecular weight: | ||
| + | ** 971.845 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** 14:1-Δ7-CoA | ||
| + | ** cis-7-tetradecenoyl-CoA | ||
| + | ** 14:1(n-7)-CoA | ||
| + | ** (7Z)-tetradec-7-enoyl-CoA | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | * | + | * [[RXN-17792]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-17791]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | = | + | |
| − | + | ||
| − | * [[ | + | |
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | {{#set: smiles=CCCCCCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} |
| − | {{#set: common name= | + | {{#set: common name=(7Z)-tetradecenoyl-CoA}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=JPIHVKICKVPFFY-TWAFKMGKSA-J}} |
| − | {{#set: | + | {{#set: molecular weight=971.845 }} |
| − | {{#set: | + | {{#set: common name=14:1-Δ7-CoA|cis-7-tetradecenoyl-CoA|14:1(n-7)-CoA|(7Z)-tetradec-7-enoyl-CoA}} |
| − | + | {{#set: consumed by=RXN-17792}} | |
| − | {{#set: | + | {{#set: produced by=RXN-17791}} |
| − | {{#set: | + | |
Latest revision as of 21:06, 21 March 2018
Contents
Metabolite CPD-19147
- smiles:
- CCCCCCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- common name:
- (7Z)-tetradecenoyl-CoA
- inchi key:
- InChIKey=JPIHVKICKVPFFY-TWAFKMGKSA-J
- molecular weight:
- 971.845
- Synonym(s):
- 14:1-Δ7-CoA
- cis-7-tetradecenoyl-CoA
- 14:1(n-7)-CoA
- (7Z)-tetradec-7-enoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCCC=CCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.
