Difference between revisions of "CPD-4586"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_8742 == * right end position: ** 6457 * transcription direction: ** NEGATIVE * left end position: ** 136 * centisome position: ** 1.367659...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4586 CPD-4586] == * smiles: ** C4(=CC5(OC1(=C(C(O)=CC2(O[CH]3(OCC[CH](C1=2)3)))C(=O)C(C(O)=...")
 
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_8742 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4586 CPD-4586] ==
* right end position:
+
* smiles:
** 6457
+
** C4(=CC5(OC1(=C(C(O)=CC2(O[CH]3(OCC[CH](C1=2)3)))C(=O)C(C(O)=C4)=5)))
* transcription direction:
+
* common name:
** NEGATIVE
+
** dihydrodemethylsterigmatocystin
* left end position:
+
* inchi key:
** 136
+
** InChIKey=WUSMTEDKVPWFDN-BWKAKNAASA-N
* centisome position:
+
* molecular weight:
** 1.367659    
+
** 312.278    
 
* Synonym(s):
 
* Synonym(s):
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* Reaction: [[ATPASE-RXN]]
+
* [[RXN-9500]]
** Source: [[annotation-in-silico_annotation]]
+
== Reaction(s) known to produce the compound ==
*** Assignment: ec-number
+
== Reaction(s) of unknown directionality ==
== Pathways associated ==
+
 
== External links  ==
 
== External links  ==
{{#set: right end position=6457}}
+
* LIGAND-CPD:
{{#set: transcription direction=NEGATIVE}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C20444 C20444]
{{#set: left end position=136}}
+
* CHEMSPIDER:
{{#set: centisome position=1.367659   }}
+
** [http://www.chemspider.com/Chemical-Structure.4588953.html 4588953]
{{#set: reaction associated=ATPASE-RXN}}
+
* PUBCHEM:
 +
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=20832874 20832874]
 +
* HMDB : HMDB33658
 +
{{#set: smiles=C4(=CC5(OC1(=C(C(O)=CC2(O[CH]3(OCC[CH](C1=2)3)))C(=O)C(C(O)=C4)=5)))}}
 +
{{#set: common name=dihydrodemethylsterigmatocystin}}
 +
{{#set: inchi key=InChIKey=WUSMTEDKVPWFDN-BWKAKNAASA-N}}
 +
{{#set: molecular weight=312.278   }}
 +
{{#set: consumed by=RXN-9500}}

Latest revision as of 21:23, 21 March 2018

Metabolite CPD-4586

  • smiles:
    • C4(=CC5(OC1(=C(C(O)=CC2(O[CH]3(OCC[CH](C1=2)3)))C(=O)C(C(O)=C4)=5)))
  • common name:
    • dihydrodemethylsterigmatocystin
  • inchi key:
    • InChIKey=WUSMTEDKVPWFDN-BWKAKNAASA-N
  • molecular weight:
    • 312.278
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C4(=CC5(OC1(=C(C(O)=CC2(O[CH]3(OCC[CH](C1=2)3)))C(=O)C(C(O)=C4)=5)))" cannot be used as a page name in this wiki.