Difference between revisions of "CPD-8613"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13417 RXN-13417] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8613 CPD-8613] == * smiles: ** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C([...")
 
(4 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13417 RXN-13417] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8613 CPD-8613] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C([O-])=O)C(O)CC3)))CC4)))C
 +
* common name:
 +
** 4α-carboxy-4β-methyl-5α-cholesta-8-en-3β-ol
 +
* inchi key:
 +
** InChIKey=GLCDBDRQLZKKOJ-LJAIZBFVSA-M
 +
* molecular weight:
 +
** 443.688   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN66-18]]
−
** 1 [[NADH]][c] '''+''' 1 [[N-4-aminobutylidene-eIF5A-lysine]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[CPD-9973]][c] '''+''' 1 [[NAD]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 NADH[c] '''+''' 1 an [eIF5A-precursor]-N-(4-aminobutylidene)-lysine[c] '''+''' 1 H+[c] '''=>''' 1 an [eIF5A-precursor]-deoxyhypusine[c] '''+''' 1 NAD+[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
== Pathways  ==
+
−
* [[PWY-5905]], hypusine biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5905 PWY-5905]
+
−
** '''5''' reactions found over '''5''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[in-silico_annotation]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: in pathway=PWY-5905}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91826592 91826592]
−
{{#set: reconstruction category=annotation}}
+
* CHEBI:
−
{{#set: reconstruction tool=pathwaytools}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87047 87047]
−
{{#set: reconstruction source=in-silico_annotation}}
+
* HMDB : HMDB12165
 +
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C([O-])=O)C(O)CC3)))CC4)))C}}
 +
{{#set: common name=4α-carboxy-4β-methyl-5α-cholesta-8-en-3β-ol}}
 +
{{#set: inchi key=InChIKey=GLCDBDRQLZKKOJ-LJAIZBFVSA-M}}
 +
{{#set: molecular weight=443.688    }}
 +
{{#set: consumed by=RXN66-18}}

Latest revision as of 20:37, 21 March 2018

Metabolite CPD-8613

  • smiles:
    • CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C([O-])=O)C(O)CC3)))CC4)))C
  • common name:
    • 4α-carboxy-4β-methyl-5α-cholesta-8-en-3β-ol
  • inchi key:
    • InChIKey=GLCDBDRQLZKKOJ-LJAIZBFVSA-M
  • molecular weight:
    • 443.688
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C([O-])=O)C(O)CC3)))CC4)))C" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-8613&oldid=42802"