Difference between revisions of "CPD66-23"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CA+2 CA+2] == * smiles: ** [Ca++] * common name: ** Ca2+ * inchi key: ** InChIKey=BHPQYMZQTOCNF...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD66-23 CPD66-23] == * smiles: ** CC(=O)C3(O)(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34)))...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD66-23 CPD66-23] == |
* smiles: | * smiles: | ||
| − | ** [ | + | ** CC(=O)C3(O)(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34)))) |
* common name: | * common name: | ||
| − | ** | + | ** 17-α-hydroxypregnenolone |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=JERGUCIJOXJXHF-TVWVXWENSA-N |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 332.482 |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | * [[ | + | * [[RXN66-350]] |
| − | + | ||
== External links == | == External links == | ||
| − | * | + | * LIPID_MAPS : LMST02030089 |
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91451 91451] |
| − | * HMDB : | + | * HMDB : HMDB00363 |
| − | + | ||
| − | + | ||
* CHEMSPIDER: | * CHEMSPIDER: | ||
| − | ** [http://www.chemspider.com/Chemical-Structure. | + | ** [http://www.chemspider.com/Chemical-Structure.217096.html 217096] |
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28750 28750] |
| − | * METABOLIGHTS : | + | * METABOLIGHTS : MTBLC28750 |
| − | {{#set: smiles=[ | + | {{#set: smiles=CC(=O)C3(O)(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))}} |
| − | {{#set: common name= | + | {{#set: common name=17-α-hydroxypregnenolone}} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: inchi key=InChIKey=JERGUCIJOXJXHF-TVWVXWENSA-N}} |
| − | {{#set: molecular weight= | + | {{#set: molecular weight=332.482 }} |
| − | + | {{#set: reversible reaction associated=RXN66-350}} | |
| − | + | ||
| − | + | ||
| − | {{#set: reversible reaction associated= | + | |
Latest revision as of 21:22, 21 March 2018
Contents
Metabolite CPD66-23
- smiles:
- CC(=O)C3(O)(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))
- common name:
- 17-α-hydroxypregnenolone
- inchi key:
- InChIKey=JERGUCIJOXJXHF-TVWVXWENSA-N
- molecular weight:
- 332.482
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- LIPID_MAPS : LMST02030089
- PUBCHEM:
- HMDB : HMDB00363
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC28750
"CC(=O)C3(O)(CC[CH]4([CH]2(CC=C1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.
